]>
Commit | Line | Data |
---|---|---|
7c673cae FG |
1 | // -*- mode:C++; tab-width:8; c-basic-offset:2; indent-tabs-mode:t -*- |
2 | // vim: ts=8 sw=2 smarttab | |
3 | /* | |
4 | * Ceph - scalable distributed file system | |
5 | * | |
6 | * Copyright (C) 2004-2006 Sage Weil <sage@newdream.net> | |
7 | * Copyright (C) 2013,2014 Cloudwatt <libre.licensing@cloudwatt.com> | |
8 | * | |
9 | * Author: Loic Dachary <loic@dachary.org> | |
10 | * | |
11 | * This is free software; you can redistribute it and/or | |
12 | * modify it under the terms of the GNU Lesser General Public | |
13 | * License version 2.1, as published by the Free Software | |
14 | * Foundation. See file COPYING. | |
15 | * | |
16 | */ | |
17 | ||
18 | ||
19 | #ifndef CEPH_OSDMAP_H | |
20 | #define CEPH_OSDMAP_H | |
21 | ||
31f18b77 FG |
22 | #include "include/cpp-btree/btree_map.h" |
23 | ||
7c673cae FG |
24 | /* |
25 | * describe properties of the OSD cluster. | |
26 | * disks, disk groups, total # osds, | |
27 | * | |
28 | */ | |
29 | #include "include/types.h" | |
30 | #include "osd_types.h" | |
31 | ||
32 | //#include "include/ceph_features.h" | |
33 | #include "crush/CrushWrapper.h" | |
34 | #include <vector> | |
35 | #include <list> | |
36 | #include <set> | |
37 | #include <map> | |
38 | #include "include/memory.h" | |
39 | using namespace std; | |
40 | ||
41 | // forward declaration | |
42 | class CephContext; | |
43 | class CrushWrapper; | |
224ce89b | 44 | class health_check_map_t; |
7c673cae FG |
45 | |
46 | // FIXME C++11 does not have std::equal for two differently-typed containers. | |
47 | // use this until we move to c++14 | |
48 | template<typename A, typename B> | |
49 | bool vectors_equal(A a, B b) | |
50 | { | |
51 | return | |
52 | a.size() == b.size() && | |
53 | (a.empty() || | |
54 | memcmp((char*)&a[0], (char*)&b[0], sizeof(a[0]) * a.size()) == 0); | |
55 | } | |
56 | ||
57 | ||
58 | /* | |
59 | * we track up to two intervals during which the osd was alive and | |
60 | * healthy. the most recent is [up_from,up_thru), where up_thru is | |
61 | * the last epoch the osd is known to have _started_. i.e., a lower | |
62 | * bound on the actual osd death. down_at (if it is > up_from) is an | |
63 | * upper bound on the actual osd death. | |
64 | * | |
65 | * the second is the last_clean interval [first,last]. in that case, | |
66 | * the last interval is the last epoch known to have been either | |
67 | * _finished_, or during which the osd cleanly shut down. when | |
68 | * possible, we push this forward to the epoch the osd was eventually | |
69 | * marked down. | |
70 | * | |
71 | * the lost_at is used to allow build_prior to proceed without waiting | |
72 | * for an osd to recover. In certain cases, progress may be blocked | |
73 | * because an osd is down that may contain updates (i.e., a pg may have | |
74 | * gone rw during an interval). If the osd can't be brought online, we | |
75 | * can force things to proceed knowing that we _might_ be losing some | |
76 | * acked writes. If the osd comes back to life later, that's fine to, | |
77 | * but those writes will still be lost (the divergent objects will be | |
78 | * thrown out). | |
79 | */ | |
80 | struct osd_info_t { | |
81 | epoch_t last_clean_begin; // last interval that ended with a clean osd shutdown | |
82 | epoch_t last_clean_end; | |
83 | epoch_t up_from; // epoch osd marked up | |
84 | epoch_t up_thru; // lower bound on actual osd death (if > up_from) | |
85 | epoch_t down_at; // upper bound on actual osd death (if > up_from) | |
86 | epoch_t lost_at; // last epoch we decided data was "lost" | |
87 | ||
88 | osd_info_t() : last_clean_begin(0), last_clean_end(0), | |
89 | up_from(0), up_thru(0), down_at(0), lost_at(0) {} | |
90 | ||
91 | void dump(Formatter *f) const; | |
92 | void encode(bufferlist& bl) const; | |
93 | void decode(bufferlist::iterator& bl); | |
94 | static void generate_test_instances(list<osd_info_t*>& o); | |
95 | }; | |
96 | WRITE_CLASS_ENCODER(osd_info_t) | |
97 | ||
98 | ostream& operator<<(ostream& out, const osd_info_t& info); | |
99 | ||
100 | struct osd_xinfo_t { | |
101 | utime_t down_stamp; ///< timestamp when we were last marked down | |
102 | float laggy_probability; ///< encoded as __u32: 0 = definitely not laggy, 0xffffffff definitely laggy | |
103 | __u32 laggy_interval; ///< average interval between being marked laggy and recovering | |
104 | uint64_t features; ///< features supported by this osd we should know about | |
105 | __u32 old_weight; ///< weight prior to being auto marked out | |
106 | ||
107 | osd_xinfo_t() : laggy_probability(0), laggy_interval(0), | |
108 | features(0), old_weight(0) {} | |
109 | ||
110 | void dump(Formatter *f) const; | |
111 | void encode(bufferlist& bl) const; | |
112 | void decode(bufferlist::iterator& bl); | |
113 | static void generate_test_instances(list<osd_xinfo_t*>& o); | |
114 | }; | |
115 | WRITE_CLASS_ENCODER(osd_xinfo_t) | |
116 | ||
117 | ostream& operator<<(ostream& out, const osd_xinfo_t& xi); | |
118 | ||
119 | ||
31f18b77 FG |
120 | struct PGTempMap { |
121 | #if 1 | |
122 | bufferlist data; | |
123 | typedef btree::btree_map<pg_t,int32_t*> map_t; | |
124 | map_t map; | |
125 | ||
126 | void encode(bufferlist& bl) const { | |
127 | uint32_t n = map.size(); | |
128 | ::encode(n, bl); | |
129 | for (auto &p : map) { | |
130 | ::encode(p.first, bl); | |
131 | bl.append((char*)p.second, (*p.second + 1) * sizeof(int32_t)); | |
132 | } | |
133 | } | |
134 | void decode(bufferlist::iterator& p) { | |
135 | data.clear(); | |
136 | map.clear(); | |
137 | uint32_t n; | |
138 | ::decode(n, p); | |
139 | if (!n) | |
140 | return; | |
141 | bufferlist::iterator pstart = p; | |
142 | size_t start_off = pstart.get_off(); | |
143 | vector<pair<pg_t,size_t>> offsets; | |
144 | offsets.resize(n); | |
145 | for (unsigned i=0; i<n; ++i) { | |
146 | pg_t pgid; | |
147 | ::decode(pgid, p); | |
148 | offsets[i].first = pgid; | |
149 | offsets[i].second = p.get_off() - start_off; | |
150 | uint32_t vn; | |
151 | ::decode(vn, p); | |
152 | p.advance(vn * sizeof(int32_t)); | |
153 | } | |
154 | size_t len = p.get_off() - start_off; | |
155 | pstart.copy(len, data); | |
156 | if (data.get_num_buffers() > 1) { | |
157 | data.rebuild(); | |
158 | } | |
159 | //map.reserve(n); | |
160 | char *start = data.c_str(); | |
161 | for (auto i : offsets) { | |
162 | map.insert(map.end(), make_pair(i.first, (int32_t*)(start + i.second))); | |
163 | } | |
164 | } | |
165 | void rebuild() { | |
166 | bufferlist bl; | |
167 | encode(bl); | |
168 | auto p = bl.begin(); | |
169 | decode(p); | |
170 | } | |
171 | friend bool operator==(const PGTempMap& l, const PGTempMap& r) { | |
172 | return | |
173 | l.map.size() == r.map.size() && | |
174 | l.data.contents_equal(r.data); | |
175 | } | |
176 | ||
177 | class iterator { | |
178 | map_t::const_iterator it; | |
179 | map_t::const_iterator end; | |
180 | pair<pg_t,vector<int32_t>> current; | |
181 | void init_current() { | |
182 | if (it != end) { | |
183 | current.first = it->first; | |
184 | assert(it->second); | |
185 | current.second.resize(*it->second); | |
186 | int32_t *p = it->second + 1; | |
187 | for (int n = 0; n < *it->second; ++n, ++p) { | |
188 | current.second[n] = *p; | |
189 | } | |
190 | } | |
191 | } | |
192 | public: | |
193 | iterator(map_t::const_iterator p, | |
194 | map_t::const_iterator e) | |
195 | : it(p), end(e) { | |
196 | init_current(); | |
197 | } | |
198 | ||
199 | const pair<pg_t,vector<int32_t>>& operator*() const { | |
200 | return current; | |
201 | } | |
202 | const pair<pg_t,vector<int32_t>>* operator->() const { | |
203 | return ¤t; | |
204 | } | |
205 | friend bool operator==(const iterator& l, const iterator& r) { | |
206 | return l.it == r.it; | |
207 | } | |
208 | friend bool operator!=(const iterator& l, const iterator& r) { | |
209 | return l.it != r.it; | |
210 | } | |
211 | iterator& operator++() { | |
212 | ++it; | |
213 | if (it != end) | |
214 | init_current(); | |
215 | return *this; | |
216 | } | |
217 | iterator operator++(int) { | |
218 | iterator r = *this; | |
219 | ++it; | |
220 | if (it != end) | |
221 | init_current(); | |
222 | return r; | |
223 | } | |
224 | }; | |
225 | iterator begin() const { | |
226 | return iterator(map.begin(), map.end()); | |
227 | } | |
228 | iterator end() const { | |
229 | return iterator(map.end(), map.end()); | |
230 | } | |
231 | iterator find(pg_t pgid) const { | |
232 | return iterator(map.find(pgid), map.end()); | |
233 | } | |
234 | size_t size() const { | |
235 | return map.size(); | |
236 | } | |
237 | size_t count(pg_t pgid) const { | |
238 | return map.count(pgid); | |
239 | } | |
240 | void erase(pg_t pgid) { | |
241 | map.erase(pgid); | |
242 | } | |
243 | void clear() { | |
244 | map.clear(); | |
245 | data.clear(); | |
246 | } | |
247 | void set(pg_t pgid, const mempool::osdmap::vector<int32_t>& v) { | |
248 | size_t need = sizeof(int32_t) * (1 + v.size()); | |
249 | if (need < data.get_append_buffer_unused_tail_length()) { | |
250 | bufferptr z(data.get_append_buffer_unused_tail_length()); | |
251 | z.zero(); | |
252 | data.append(z.c_str(), z.length()); | |
253 | } | |
254 | ::encode(v, data); | |
255 | map[pgid] = (int32_t*)(data.back().end_c_str()) - (1 + v.size()); | |
256 | } | |
257 | mempool::osdmap::vector<int32_t> get(pg_t pgid) { | |
258 | mempool::osdmap::vector<int32_t> v; | |
259 | int32_t *p = map[pgid]; | |
260 | size_t n = *p++; | |
261 | v.resize(n); | |
262 | for (size_t i = 0; i < n; ++i, ++p) { | |
263 | v[i] = *p; | |
264 | } | |
265 | return v; | |
266 | } | |
267 | #else | |
268 | // trivial implementation | |
269 | mempool::osdmap::map<pg_t,mempool::osdmap::vector<int32_t> > pg_temp; | |
270 | ||
271 | void encode(bufferlist& bl) const { | |
272 | ::encode(pg_temp, bl); | |
273 | } | |
274 | void decode(bufferlist::iterator& p) { | |
275 | ::decode(pg_temp, p); | |
276 | } | |
277 | friend bool operator==(const PGTempMap& l, const PGTempMap& r) { | |
278 | return | |
279 | l.pg_temp.size() == r.pg_temp.size() && | |
280 | l.pg_temp == r.pg_temp; | |
281 | } | |
282 | ||
283 | class iterator { | |
284 | mempool::osdmap::map<pg_t,mempool::osdmap::vector<int32_t> >::const_iterator it; | |
285 | public: | |
286 | iterator(mempool::osdmap::map<pg_t, | |
287 | mempool::osdmap::vector<int32_t> >::const_iterator p) | |
288 | : it(p) {} | |
289 | ||
290 | pair<pg_t,const mempool::osdmap::vector<int32_t>&> operator*() const { | |
291 | return *it; | |
292 | } | |
293 | const pair<const pg_t,mempool::osdmap::vector<int32_t>>* operator->() const { | |
294 | return &*it; | |
295 | } | |
296 | friend bool operator==(const iterator& l, const iterator& r) { | |
297 | return l.it == r.it; | |
298 | } | |
299 | friend bool operator!=(const iterator& l, const iterator& r) { | |
300 | return l.it != r.it; | |
301 | } | |
302 | iterator& operator++() { | |
303 | ++it; | |
304 | return *this; | |
305 | } | |
306 | iterator operator++(int) { | |
307 | iterator r = *this; | |
308 | ++it; | |
309 | return r; | |
310 | } | |
311 | }; | |
312 | iterator begin() const { | |
313 | return iterator(pg_temp.cbegin()); | |
314 | } | |
315 | iterator end() const { | |
316 | return iterator(pg_temp.cend()); | |
317 | } | |
318 | iterator find(pg_t pgid) const { | |
319 | return iterator(pg_temp.find(pgid)); | |
320 | } | |
321 | size_t size() const { | |
322 | return pg_temp.size(); | |
323 | } | |
324 | size_t count(pg_t pgid) const { | |
325 | return pg_temp.count(pgid); | |
326 | } | |
327 | void erase(pg_t pgid) { | |
328 | pg_temp.erase(pgid); | |
329 | } | |
330 | void clear() { | |
331 | pg_temp.clear(); | |
332 | } | |
333 | void set(pg_t pgid, const mempool::osdmap::vector<int32_t>& v) { | |
334 | pg_temp[pgid] = v; | |
335 | } | |
336 | const mempool::osdmap::vector<int32_t>& get(pg_t pgid) { | |
337 | return pg_temp.at(pgid); | |
338 | } | |
339 | #endif | |
340 | void dump(Formatter *f) const { | |
341 | for (const auto &pg : *this) { | |
342 | f->open_object_section("osds"); | |
343 | f->dump_stream("pgid") << pg.first; | |
344 | f->open_array_section("osds"); | |
345 | for (const auto osd : pg.second) | |
346 | f->dump_int("osd", osd); | |
347 | f->close_section(); | |
348 | f->close_section(); | |
349 | } | |
350 | } | |
351 | }; | |
352 | WRITE_CLASS_ENCODER(PGTempMap) | |
353 | ||
7c673cae FG |
354 | /** OSDMap |
355 | */ | |
356 | class OSDMap { | |
357 | public: | |
358 | MEMPOOL_CLASS_HELPERS(); | |
359 | ||
360 | class Incremental { | |
361 | public: | |
362 | MEMPOOL_CLASS_HELPERS(); | |
363 | ||
364 | /// feature bits we were encoded with. the subsequent OSDMap | |
365 | /// encoding should match. | |
366 | uint64_t encode_features; | |
367 | uuid_d fsid; | |
368 | epoch_t epoch; // new epoch; we are a diff from epoch-1 to epoch | |
369 | utime_t modified; | |
370 | int64_t new_pool_max; //incremented by the OSDMonitor on each pool create | |
371 | int32_t new_flags; | |
31f18b77 | 372 | int8_t new_require_osd_release = -1; |
7c673cae FG |
373 | |
374 | // full (rare) | |
375 | bufferlist fullmap; // in lieu of below. | |
376 | bufferlist crush; | |
377 | ||
378 | // incremental | |
379 | int32_t new_max_osd; | |
380 | mempool::osdmap::map<int64_t,pg_pool_t> new_pools; | |
381 | mempool::osdmap::map<int64_t,string> new_pool_names; | |
382 | mempool::osdmap::set<int64_t> old_pools; | |
383 | mempool::osdmap::map<string,map<string,string> > new_erasure_code_profiles; | |
384 | mempool::osdmap::vector<string> old_erasure_code_profiles; | |
385 | mempool::osdmap::map<int32_t,entity_addr_t> new_up_client; | |
386 | mempool::osdmap::map<int32_t,entity_addr_t> new_up_cluster; | |
31f18b77 | 387 | mempool::osdmap::map<int32_t,uint32_t> new_state; // XORed onto previous state. |
7c673cae FG |
388 | mempool::osdmap::map<int32_t,uint32_t> new_weight; |
389 | mempool::osdmap::map<pg_t,mempool::osdmap::vector<int32_t> > new_pg_temp; // [] to remove | |
390 | mempool::osdmap::map<pg_t, int32_t> new_primary_temp; // [-1] to remove | |
391 | mempool::osdmap::map<int32_t,uint32_t> new_primary_affinity; | |
392 | mempool::osdmap::map<int32_t,epoch_t> new_up_thru; | |
393 | mempool::osdmap::map<int32_t,pair<epoch_t,epoch_t> > new_last_clean_interval; | |
394 | mempool::osdmap::map<int32_t,epoch_t> new_lost; | |
395 | mempool::osdmap::map<int32_t,uuid_d> new_uuid; | |
396 | mempool::osdmap::map<int32_t,osd_xinfo_t> new_xinfo; | |
397 | ||
398 | mempool::osdmap::map<entity_addr_t,utime_t> new_blacklist; | |
399 | mempool::osdmap::vector<entity_addr_t> old_blacklist; | |
400 | mempool::osdmap::map<int32_t, entity_addr_t> new_hb_back_up; | |
401 | mempool::osdmap::map<int32_t, entity_addr_t> new_hb_front_up; | |
402 | ||
403 | mempool::osdmap::map<pg_t,mempool::osdmap::vector<int32_t>> new_pg_upmap; | |
404 | mempool::osdmap::map<pg_t,mempool::osdmap::vector<pair<int32_t,int32_t>>> new_pg_upmap_items; | |
405 | mempool::osdmap::set<pg_t> old_pg_upmap, old_pg_upmap_items; | |
406 | ||
407 | string cluster_snapshot; | |
408 | ||
409 | float new_nearfull_ratio = -1; | |
410 | float new_backfillfull_ratio = -1; | |
411 | float new_full_ratio = -1; | |
412 | ||
31f18b77 | 413 | int8_t new_require_min_compat_client = -1; |
7c673cae FG |
414 | |
415 | mutable bool have_crc; ///< crc values are defined | |
416 | uint32_t full_crc; ///< crc of the resulting OSDMap | |
417 | mutable uint32_t inc_crc; ///< crc of this incremental | |
418 | ||
419 | int get_net_marked_out(const OSDMap *previous) const; | |
420 | int get_net_marked_down(const OSDMap *previous) const; | |
421 | int identify_osd(uuid_d u) const; | |
422 | ||
423 | void encode_client_old(bufferlist& bl) const; | |
424 | void encode_classic(bufferlist& bl, uint64_t features) const; | |
425 | void encode(bufferlist& bl, uint64_t features=CEPH_FEATURES_ALL) const; | |
426 | void decode_classic(bufferlist::iterator &p); | |
427 | void decode(bufferlist::iterator &bl); | |
428 | void dump(Formatter *f) const; | |
429 | static void generate_test_instances(list<Incremental*>& o); | |
430 | ||
431 | explicit Incremental(epoch_t e=0) : | |
432 | encode_features(0), | |
433 | epoch(e), new_pool_max(-1), new_flags(-1), new_max_osd(-1), | |
434 | have_crc(false), full_crc(0), inc_crc(0) { | |
435 | memset(&fsid, 0, sizeof(fsid)); | |
436 | } | |
437 | explicit Incremental(bufferlist &bl) { | |
438 | bufferlist::iterator p = bl.begin(); | |
439 | decode(p); | |
440 | } | |
441 | explicit Incremental(bufferlist::iterator &p) { | |
442 | decode(p); | |
443 | } | |
444 | ||
445 | pg_pool_t *get_new_pool(int64_t pool, const pg_pool_t *orig) { | |
446 | if (new_pools.count(pool) == 0) | |
447 | new_pools[pool] = *orig; | |
448 | return &new_pools[pool]; | |
449 | } | |
450 | bool has_erasure_code_profile(const string &name) const { | |
451 | auto i = new_erasure_code_profiles.find(name); | |
452 | return i != new_erasure_code_profiles.end(); | |
453 | } | |
454 | void set_erasure_code_profile(const string &name, | |
455 | const map<string,string>& profile) { | |
456 | new_erasure_code_profiles[name] = profile; | |
457 | } | |
458 | ||
459 | /// propage update pools' snap metadata to any of their tiers | |
460 | int propagate_snaps_to_tiers(CephContext *cct, const OSDMap &base); | |
31f18b77 FG |
461 | |
462 | /// filter out osds with any pending state changing | |
463 | size_t get_pending_state_osds(vector<int> *osds) { | |
464 | assert(osds); | |
465 | osds->clear(); | |
466 | ||
467 | for (auto &p : new_state) { | |
468 | osds->push_back(p.first); | |
469 | } | |
470 | ||
471 | return osds->size(); | |
472 | } | |
473 | ||
474 | bool pending_osd_has_state(int osd, unsigned state) { | |
475 | return new_state.count(osd) && (new_state[osd] & state) != 0; | |
476 | } | |
477 | ||
478 | void pending_osd_state_set(int osd, unsigned state) { | |
479 | new_state[osd] |= state; | |
480 | } | |
481 | ||
482 | // cancel the specified pending osd state if there is any | |
483 | // return ture on success, false otherwise. | |
484 | bool pending_osd_state_clear(int osd, unsigned state) { | |
485 | if (!pending_osd_has_state(osd, state)) { | |
486 | // never has been set or already has been cancelled. | |
487 | return false; | |
488 | } | |
489 | ||
490 | new_state[osd] &= ~state; | |
491 | return true; | |
492 | } | |
493 | ||
7c673cae FG |
494 | }; |
495 | ||
496 | private: | |
497 | uuid_d fsid; | |
498 | epoch_t epoch; // what epoch of the osd cluster descriptor is this | |
499 | utime_t created, modified; // epoch start time | |
500 | int32_t pool_max; // the largest pool num, ever | |
501 | ||
502 | uint32_t flags; | |
503 | ||
504 | int num_osd; // not saved; see calc_num_osds | |
505 | int num_up_osd; // not saved; see calc_num_osds | |
506 | int num_in_osd; // not saved; see calc_num_osds | |
507 | ||
508 | int32_t max_osd; | |
31f18b77 | 509 | vector<uint32_t> osd_state; |
7c673cae FG |
510 | |
511 | struct addrs_s { | |
512 | mempool::osdmap::vector<ceph::shared_ptr<entity_addr_t> > client_addr; | |
513 | mempool::osdmap::vector<ceph::shared_ptr<entity_addr_t> > cluster_addr; | |
514 | mempool::osdmap::vector<ceph::shared_ptr<entity_addr_t> > hb_back_addr; | |
515 | mempool::osdmap::vector<ceph::shared_ptr<entity_addr_t> > hb_front_addr; | |
516 | entity_addr_t blank; | |
517 | }; | |
518 | ceph::shared_ptr<addrs_s> osd_addrs; | |
519 | ||
520 | mempool::osdmap::vector<__u32> osd_weight; // 16.16 fixed point, 0x10000 = "in", 0 = "out" | |
521 | mempool::osdmap::vector<osd_info_t> osd_info; | |
31f18b77 | 522 | ceph::shared_ptr<PGTempMap> pg_temp; // temp pg mapping (e.g. while we rebuild) |
7c673cae FG |
523 | ceph::shared_ptr< mempool::osdmap::map<pg_t,int32_t > > primary_temp; // temp primary mapping (e.g. while we rebuild) |
524 | ceph::shared_ptr< mempool::osdmap::vector<__u32> > osd_primary_affinity; ///< 16.16 fixed point, 0x10000 = baseline | |
525 | ||
526 | // remap (post-CRUSH, pre-up) | |
527 | mempool::osdmap::map<pg_t,mempool::osdmap::vector<int32_t>> pg_upmap; ///< remap pg | |
528 | mempool::osdmap::map<pg_t,mempool::osdmap::vector<pair<int32_t,int32_t>>> pg_upmap_items; ///< remap osds in up set | |
529 | ||
530 | mempool::osdmap::map<int64_t,pg_pool_t> pools; | |
531 | mempool::osdmap::map<int64_t,string> pool_name; | |
532 | mempool::osdmap::map<string,map<string,string> > erasure_code_profiles; | |
533 | mempool::osdmap::map<string,int64_t> name_pool; | |
534 | ||
535 | ceph::shared_ptr< mempool::osdmap::vector<uuid_d> > osd_uuid; | |
536 | mempool::osdmap::vector<osd_xinfo_t> osd_xinfo; | |
537 | ||
538 | mempool::osdmap::unordered_map<entity_addr_t,utime_t> blacklist; | |
539 | ||
540 | epoch_t cluster_snapshot_epoch; | |
541 | string cluster_snapshot; | |
542 | bool new_blacklist_entries; | |
543 | ||
544 | float full_ratio = 0, backfillfull_ratio = 0, nearfull_ratio = 0; | |
545 | ||
546 | /// min compat client we want to support | |
31f18b77 | 547 | uint8_t require_min_compat_client = 0; // CEPH_RELEASE_* |
7c673cae | 548 | |
31f18b77 FG |
549 | public: |
550 | /// require osds to run at least this release | |
551 | uint8_t require_osd_release = 0; // CEPH_RELEASE_* | |
552 | ||
553 | private: | |
7c673cae FG |
554 | mutable uint64_t cached_up_osd_features; |
555 | ||
556 | mutable bool crc_defined; | |
557 | mutable uint32_t crc; | |
558 | ||
559 | void _calc_up_osd_features(); | |
560 | ||
561 | public: | |
562 | bool have_crc() const { return crc_defined; } | |
563 | uint32_t get_crc() const { return crc; } | |
564 | ||
565 | ceph::shared_ptr<CrushWrapper> crush; // hierarchical map | |
31f18b77 FG |
566 | private: |
567 | uint32_t crush_version = 1; | |
7c673cae FG |
568 | |
569 | friend class OSDMonitor; | |
570 | ||
571 | public: | |
572 | OSDMap() : epoch(0), | |
224ce89b | 573 | pool_max(0), |
7c673cae FG |
574 | flags(0), |
575 | num_osd(0), num_up_osd(0), num_in_osd(0), | |
576 | max_osd(0), | |
577 | osd_addrs(std::make_shared<addrs_s>()), | |
31f18b77 | 578 | pg_temp(std::make_shared<PGTempMap>()), |
7c673cae FG |
579 | primary_temp(std::make_shared<mempool::osdmap::map<pg_t,int32_t>>()), |
580 | osd_uuid(std::make_shared<mempool::osdmap::vector<uuid_d>>()), | |
581 | cluster_snapshot_epoch(0), | |
582 | new_blacklist_entries(false), | |
583 | cached_up_osd_features(0), | |
584 | crc_defined(false), crc(0), | |
585 | crush(std::make_shared<CrushWrapper>()) { | |
586 | memset(&fsid, 0, sizeof(fsid)); | |
587 | } | |
588 | ||
589 | // no copying | |
590 | private: | |
591 | OSDMap(const OSDMap& other) = default; | |
592 | OSDMap& operator=(const OSDMap& other) = default; | |
593 | public: | |
594 | ||
595 | void deepish_copy_from(const OSDMap& o) { | |
596 | *this = o; | |
597 | primary_temp.reset(new mempool::osdmap::map<pg_t,int32_t>(*o.primary_temp)); | |
31f18b77 | 598 | pg_temp.reset(new PGTempMap(*o.pg_temp)); |
7c673cae FG |
599 | osd_uuid.reset(new mempool::osdmap::vector<uuid_d>(*o.osd_uuid)); |
600 | ||
601 | if (o.osd_primary_affinity) | |
602 | osd_primary_affinity.reset(new mempool::osdmap::vector<__u32>(*o.osd_primary_affinity)); | |
603 | ||
604 | // NOTE: this still references shared entity_addr_t's. | |
605 | osd_addrs.reset(new addrs_s(*o.osd_addrs)); | |
606 | ||
607 | // NOTE: we do not copy crush. note that apply_incremental will | |
608 | // allocate a new CrushWrapper, though. | |
609 | } | |
610 | ||
611 | // map info | |
612 | const uuid_d& get_fsid() const { return fsid; } | |
613 | void set_fsid(uuid_d& f) { fsid = f; } | |
614 | ||
615 | epoch_t get_epoch() const { return epoch; } | |
616 | void inc_epoch() { epoch++; } | |
617 | ||
618 | void set_epoch(epoch_t e); | |
619 | ||
31f18b77 FG |
620 | uint32_t get_crush_version() const { |
621 | return crush_version; | |
622 | } | |
623 | ||
7c673cae FG |
624 | /* stamps etc */ |
625 | const utime_t& get_created() const { return created; } | |
626 | const utime_t& get_modified() const { return modified; } | |
627 | ||
628 | bool is_blacklisted(const entity_addr_t& a) const; | |
629 | void get_blacklist(list<pair<entity_addr_t,utime_t > > *bl) const; | |
31f18b77 | 630 | void get_blacklist(std::set<entity_addr_t> *bl) const; |
7c673cae FG |
631 | |
632 | string get_cluster_snapshot() const { | |
633 | if (cluster_snapshot_epoch == epoch) | |
634 | return cluster_snapshot; | |
635 | return string(); | |
636 | } | |
637 | ||
638 | float get_full_ratio() const { | |
639 | return full_ratio; | |
640 | } | |
641 | float get_backfillfull_ratio() const { | |
642 | return backfillfull_ratio; | |
643 | } | |
644 | float get_nearfull_ratio() const { | |
645 | return nearfull_ratio; | |
646 | } | |
7c673cae | 647 | void get_full_osd_util( |
31f18b77 | 648 | const mempool::pgmap::unordered_map<int32_t,osd_stat_t> &osd_stat, |
7c673cae FG |
649 | map<int, float> *full, |
650 | map<int, float> *backfill, | |
651 | map<int, float> *nearfull) const; | |
3efd9988 FG |
652 | void get_full_pools(CephContext *cct, |
653 | set<int64_t> *full, | |
654 | set<int64_t> *backfillfull, | |
655 | set<int64_t> *nearfull) const; | |
31f18b77 FG |
656 | void get_full_osd_counts(set<int> *full, set<int> *backfill, |
657 | set<int> *nearfull) const; | |
658 | ||
659 | ||
7c673cae FG |
660 | /***** cluster state *****/ |
661 | /* osds */ | |
662 | int get_max_osd() const { return max_osd; } | |
663 | void set_max_osd(int m); | |
664 | ||
665 | unsigned get_num_osds() const { | |
666 | return num_osd; | |
667 | } | |
668 | unsigned get_num_up_osds() const { | |
669 | return num_up_osd; | |
670 | } | |
671 | unsigned get_num_in_osds() const { | |
672 | return num_in_osd; | |
673 | } | |
674 | /// recalculate cached values for get_num{,_up,_in}_osds | |
675 | int calc_num_osds(); | |
676 | ||
677 | void get_all_osds(set<int32_t>& ls) const; | |
678 | void get_up_osds(set<int32_t>& ls) const; | |
31f18b77 | 679 | void get_out_osds(set<int32_t>& ls) const; |
7c673cae FG |
680 | unsigned get_num_pg_temp() const { |
681 | return pg_temp->size(); | |
682 | } | |
683 | ||
684 | int get_flags() const { return flags; } | |
685 | bool test_flag(int f) const { return flags & f; } | |
686 | void set_flag(int f) { flags |= f; } | |
687 | void clear_flag(int f) { flags &= ~f; } | |
688 | ||
689 | static void calc_state_set(int state, set<string>& st); | |
690 | ||
691 | int get_state(int o) const { | |
692 | assert(o < max_osd); | |
693 | return osd_state[o]; | |
694 | } | |
695 | int get_state(int o, set<string>& st) const { | |
696 | assert(o < max_osd); | |
697 | unsigned t = osd_state[o]; | |
698 | calc_state_set(t, st); | |
699 | return osd_state[o]; | |
700 | } | |
701 | void set_state(int o, unsigned s) { | |
702 | assert(o < max_osd); | |
703 | osd_state[o] = s; | |
704 | } | |
705 | void set_weight(int o, unsigned w) { | |
706 | assert(o < max_osd); | |
707 | osd_weight[o] = w; | |
708 | if (w) | |
709 | osd_state[o] |= CEPH_OSD_EXISTS; | |
710 | } | |
711 | unsigned get_weight(int o) const { | |
712 | assert(o < max_osd); | |
713 | return osd_weight[o]; | |
714 | } | |
715 | float get_weightf(int o) const { | |
716 | return (float)get_weight(o) / (float)CEPH_OSD_IN; | |
717 | } | |
718 | void adjust_osd_weights(const map<int,double>& weights, Incremental& inc) const; | |
719 | ||
720 | void set_primary_affinity(int o, int w) { | |
721 | assert(o < max_osd); | |
722 | if (!osd_primary_affinity) | |
723 | osd_primary_affinity.reset( | |
724 | new mempool::osdmap::vector<__u32>( | |
725 | max_osd, CEPH_OSD_DEFAULT_PRIMARY_AFFINITY)); | |
726 | (*osd_primary_affinity)[o] = w; | |
727 | } | |
728 | unsigned get_primary_affinity(int o) const { | |
729 | assert(o < max_osd); | |
730 | if (!osd_primary_affinity) | |
731 | return CEPH_OSD_DEFAULT_PRIMARY_AFFINITY; | |
732 | return (*osd_primary_affinity)[o]; | |
733 | } | |
734 | float get_primary_affinityf(int o) const { | |
735 | return (float)get_primary_affinity(o) / (float)CEPH_OSD_MAX_PRIMARY_AFFINITY; | |
736 | } | |
737 | ||
738 | bool has_erasure_code_profile(const string &name) const { | |
739 | auto i = erasure_code_profiles.find(name); | |
740 | return i != erasure_code_profiles.end(); | |
741 | } | |
742 | int get_erasure_code_profile_default(CephContext *cct, | |
743 | map<string,string> &profile_map, | |
744 | ostream *ss); | |
745 | void set_erasure_code_profile(const string &name, | |
746 | const map<string,string>& profile) { | |
747 | erasure_code_profiles[name] = profile; | |
748 | } | |
749 | const map<string,string> &get_erasure_code_profile( | |
750 | const string &name) const { | |
751 | static map<string,string> empty; | |
752 | auto i = erasure_code_profiles.find(name); | |
753 | if (i == erasure_code_profiles.end()) | |
754 | return empty; | |
755 | else | |
756 | return i->second; | |
757 | } | |
758 | const mempool::osdmap::map<string,map<string,string> > &get_erasure_code_profiles() const { | |
759 | return erasure_code_profiles; | |
760 | } | |
761 | ||
762 | bool exists(int osd) const { | |
763 | //assert(osd >= 0); | |
764 | return osd >= 0 && osd < max_osd && (osd_state[osd] & CEPH_OSD_EXISTS); | |
765 | } | |
766 | ||
31f18b77 FG |
767 | bool is_destroyed(int osd) const { |
768 | return exists(osd) && (osd_state[osd] & CEPH_OSD_DESTROYED); | |
769 | } | |
770 | ||
7c673cae FG |
771 | bool is_up(int osd) const { |
772 | return exists(osd) && (osd_state[osd] & CEPH_OSD_UP); | |
773 | } | |
774 | ||
775 | bool has_been_up_since(int osd, epoch_t epoch) const { | |
776 | return is_up(osd) && get_up_from(osd) <= epoch; | |
777 | } | |
778 | ||
779 | bool is_down(int osd) const { | |
780 | return !is_up(osd); | |
781 | } | |
782 | ||
783 | bool is_out(int osd) const { | |
784 | return !exists(osd) || get_weight(osd) == CEPH_OSD_OUT; | |
785 | } | |
786 | ||
787 | bool is_in(int osd) const { | |
788 | return !is_out(osd); | |
789 | } | |
790 | ||
31f18b77 FG |
791 | bool is_noup(int osd) const { |
792 | return exists(osd) && (osd_state[osd] & CEPH_OSD_NOUP); | |
793 | } | |
794 | ||
795 | bool is_nodown(int osd) const { | |
796 | return exists(osd) && (osd_state[osd] & CEPH_OSD_NODOWN); | |
797 | } | |
798 | ||
799 | bool is_noin(int osd) const { | |
800 | return exists(osd) && (osd_state[osd] & CEPH_OSD_NOIN); | |
801 | } | |
802 | ||
803 | bool is_noout(int osd) const { | |
804 | return exists(osd) && (osd_state[osd] & CEPH_OSD_NOOUT); | |
805 | } | |
806 | ||
807 | void get_noup_osds(vector<int> *osds) const { | |
808 | assert(osds); | |
809 | osds->clear(); | |
810 | ||
811 | for (int i = 0; i < max_osd; i++) { | |
812 | if (is_noup(i)) { | |
813 | osds->push_back(i); | |
814 | } | |
815 | } | |
816 | } | |
817 | ||
818 | void get_nodown_osds(vector<int> *osds) const { | |
819 | assert(osds); | |
820 | osds->clear(); | |
821 | ||
822 | for (int i = 0; i < max_osd; i++) { | |
823 | if (is_nodown(i)) { | |
824 | osds->push_back(i); | |
825 | } | |
826 | } | |
827 | } | |
828 | ||
829 | void get_noin_osds(vector<int> *osds) const { | |
830 | assert(osds); | |
831 | osds->clear(); | |
832 | ||
833 | for (int i = 0; i < max_osd; i++) { | |
834 | if (is_noin(i)) { | |
835 | osds->push_back(i); | |
836 | } | |
837 | } | |
838 | } | |
839 | ||
840 | void get_noout_osds(vector<int> *osds) const { | |
841 | assert(osds); | |
842 | osds->clear(); | |
843 | ||
844 | for (int i = 0; i < max_osd; i++) { | |
845 | if (is_noout(i)) { | |
846 | osds->push_back(i); | |
847 | } | |
848 | } | |
849 | } | |
850 | ||
7c673cae FG |
851 | /** |
852 | * check if an entire crush subtree is down | |
853 | */ | |
854 | bool subtree_is_down(int id, set<int> *down_cache) const; | |
855 | bool containing_subtree_is_down(CephContext *cct, int osd, int subtree_type, set<int> *down_cache) const; | |
856 | ||
31f18b77 FG |
857 | bool subtree_type_is_down(CephContext *cct, int id, int subtree_type, set<int> *down_in_osds, set<int> *up_in_osds, |
858 | set<int> *subtree_up, unordered_map<int, set<int> > *subtree_type_down) const; | |
859 | ||
7c673cae FG |
860 | int identify_osd(const entity_addr_t& addr) const; |
861 | int identify_osd(const uuid_d& u) const; | |
862 | int identify_osd_on_all_channels(const entity_addr_t& addr) const; | |
863 | ||
864 | bool have_addr(const entity_addr_t& addr) const { | |
865 | return identify_osd(addr) >= 0; | |
866 | } | |
867 | int find_osd_on_ip(const entity_addr_t& ip) const; | |
868 | const entity_addr_t &get_addr(int osd) const { | |
869 | assert(exists(osd)); | |
870 | return osd_addrs->client_addr[osd] ? *osd_addrs->client_addr[osd] : osd_addrs->blank; | |
871 | } | |
872 | const entity_addr_t &get_cluster_addr(int osd) const { | |
873 | assert(exists(osd)); | |
874 | if (!osd_addrs->cluster_addr[osd] || *osd_addrs->cluster_addr[osd] == entity_addr_t()) | |
875 | return get_addr(osd); | |
876 | return *osd_addrs->cluster_addr[osd]; | |
877 | } | |
878 | const entity_addr_t &get_hb_back_addr(int osd) const { | |
879 | assert(exists(osd)); | |
880 | return osd_addrs->hb_back_addr[osd] ? *osd_addrs->hb_back_addr[osd] : osd_addrs->blank; | |
881 | } | |
882 | const entity_addr_t &get_hb_front_addr(int osd) const { | |
883 | assert(exists(osd)); | |
884 | return osd_addrs->hb_front_addr[osd] ? *osd_addrs->hb_front_addr[osd] : osd_addrs->blank; | |
885 | } | |
886 | entity_inst_t get_most_recent_inst(int osd) const { | |
887 | assert(exists(osd)); | |
888 | return entity_inst_t(entity_name_t::OSD(osd), get_addr(osd)); | |
889 | } | |
890 | entity_inst_t get_inst(int osd) const { | |
891 | assert(is_up(osd)); | |
892 | return get_most_recent_inst(osd); | |
893 | } | |
894 | entity_inst_t get_cluster_inst(int osd) const { | |
895 | assert(is_up(osd)); | |
896 | return entity_inst_t(entity_name_t::OSD(osd), get_cluster_addr(osd)); | |
897 | } | |
898 | entity_inst_t get_hb_back_inst(int osd) const { | |
899 | assert(is_up(osd)); | |
900 | return entity_inst_t(entity_name_t::OSD(osd), get_hb_back_addr(osd)); | |
901 | } | |
902 | entity_inst_t get_hb_front_inst(int osd) const { | |
903 | assert(is_up(osd)); | |
904 | return entity_inst_t(entity_name_t::OSD(osd), get_hb_front_addr(osd)); | |
905 | } | |
906 | ||
907 | const uuid_d& get_uuid(int osd) const { | |
908 | assert(exists(osd)); | |
909 | return (*osd_uuid)[osd]; | |
910 | } | |
911 | ||
912 | const epoch_t& get_up_from(int osd) const { | |
913 | assert(exists(osd)); | |
914 | return osd_info[osd].up_from; | |
915 | } | |
916 | const epoch_t& get_up_thru(int osd) const { | |
917 | assert(exists(osd)); | |
918 | return osd_info[osd].up_thru; | |
919 | } | |
920 | const epoch_t& get_down_at(int osd) const { | |
921 | assert(exists(osd)); | |
922 | return osd_info[osd].down_at; | |
923 | } | |
924 | const osd_info_t& get_info(int osd) const { | |
925 | assert(osd < max_osd); | |
926 | return osd_info[osd]; | |
927 | } | |
928 | ||
929 | const osd_xinfo_t& get_xinfo(int osd) const { | |
930 | assert(osd < max_osd); | |
931 | return osd_xinfo[osd]; | |
932 | } | |
933 | ||
934 | int get_next_up_osd_after(int n) const { | |
935 | if (get_max_osd() == 0) | |
936 | return -1; | |
937 | for (int i = n + 1; i != n; ++i) { | |
938 | if (i >= get_max_osd()) | |
939 | i = 0; | |
940 | if (i == n) | |
941 | break; | |
942 | if (is_up(i)) | |
943 | return i; | |
944 | } | |
945 | return -1; | |
946 | } | |
947 | ||
948 | int get_previous_up_osd_before(int n) const { | |
949 | if (get_max_osd() == 0) | |
950 | return -1; | |
951 | for (int i = n - 1; i != n; --i) { | |
952 | if (i < 0) | |
953 | i = get_max_osd() - 1; | |
954 | if (i == n) | |
955 | break; | |
956 | if (is_up(i)) | |
957 | return i; | |
958 | } | |
959 | return -1; | |
960 | } | |
961 | ||
962 | /** | |
963 | * get feature bits required by the current structure | |
964 | * | |
965 | * @param entity_type [in] what entity type we are asking about | |
966 | * @param mask [out] set of all possible map-related features we could set | |
967 | * @return feature bits used by this map | |
968 | */ | |
969 | uint64_t get_features(int entity_type, uint64_t *mask) const; | |
970 | ||
971 | /** | |
972 | * get oldest *client* version (firefly, hammer, etc.) that can connect given | |
973 | * the feature bits required (according to get_features()). | |
974 | */ | |
31f18b77 | 975 | uint8_t get_min_compat_client() const; |
7c673cae FG |
976 | |
977 | /** | |
978 | * get intersection of features supported by up osds | |
979 | */ | |
980 | uint64_t get_up_osd_features() const; | |
981 | ||
982 | int apply_incremental(const Incremental &inc); | |
983 | ||
984 | /// try to re-use/reference addrs in oldmap from newmap | |
985 | static void dedup(const OSDMap *oldmap, OSDMap *newmap); | |
986 | ||
987 | static void clean_temps(CephContext *cct, const OSDMap& osdmap, | |
988 | Incremental *pending_inc); | |
989 | ||
990 | // serialize, unserialize | |
991 | private: | |
992 | void encode_client_old(bufferlist& bl) const; | |
993 | void encode_classic(bufferlist& bl, uint64_t features) const; | |
994 | void decode_classic(bufferlist::iterator& p); | |
995 | void post_decode(); | |
996 | public: | |
997 | void encode(bufferlist& bl, uint64_t features=CEPH_FEATURES_ALL) const; | |
998 | void decode(bufferlist& bl); | |
999 | void decode(bufferlist::iterator& bl); | |
1000 | ||
1001 | ||
1002 | /**** mapping facilities ****/ | |
1003 | int map_to_pg( | |
1004 | int64_t pool, | |
1005 | const string& name, | |
1006 | const string& key, | |
1007 | const string& nspace, | |
1008 | pg_t *pg) const; | |
1009 | int object_locator_to_pg(const object_t& oid, const object_locator_t& loc, | |
1010 | pg_t &pg) const; | |
1011 | pg_t object_locator_to_pg(const object_t& oid, | |
1012 | const object_locator_t& loc) const { | |
1013 | pg_t pg; | |
1014 | int ret = object_locator_to_pg(oid, loc, pg); | |
1015 | assert(ret == 0); | |
1016 | return pg; | |
1017 | } | |
1018 | ||
1019 | ||
1020 | static object_locator_t file_to_object_locator(const file_layout_t& layout) { | |
1021 | return object_locator_t(layout.pool_id, layout.pool_ns); | |
1022 | } | |
1023 | ||
1024 | ceph_object_layout file_to_object_layout(object_t oid, | |
1025 | file_layout_t& layout) const { | |
1026 | return make_object_layout(oid, layout.pool_id, layout.pool_ns); | |
1027 | } | |
1028 | ||
1029 | ceph_object_layout make_object_layout(object_t oid, int pg_pool, | |
1030 | string nspace) const; | |
1031 | ||
1032 | int get_pg_num(int pg_pool) const | |
1033 | { | |
1034 | const pg_pool_t *pool = get_pg_pool(pg_pool); | |
1035 | assert(NULL != pool); | |
1036 | return pool->get_pg_num(); | |
1037 | } | |
1038 | ||
1039 | bool pg_exists(pg_t pgid) const { | |
1040 | const pg_pool_t *p = get_pg_pool(pgid.pool()); | |
1041 | return p && pgid.ps() < p->get_pg_num(); | |
1042 | } | |
1043 | ||
224ce89b WB |
1044 | int get_pg_pool_min_size(pg_t pgid) const { |
1045 | if (!pg_exists(pgid)) { | |
1046 | return -ENOENT; | |
1047 | } | |
1048 | const pg_pool_t *p = get_pg_pool(pgid.pool()); | |
1049 | assert(p); | |
1050 | return p->get_min_size(); | |
1051 | } | |
1052 | ||
1053 | int get_pg_pool_size(pg_t pgid) const { | |
1054 | if (!pg_exists(pgid)) { | |
1055 | return -ENOENT; | |
1056 | } | |
1057 | const pg_pool_t *p = get_pg_pool(pgid.pool()); | |
1058 | assert(p); | |
1059 | return p->get_size(); | |
1060 | } | |
1061 | ||
7c673cae FG |
1062 | private: |
1063 | /// pg -> (raw osd list) | |
31f18b77 | 1064 | void _pg_to_raw_osds( |
7c673cae FG |
1065 | const pg_pool_t& pool, pg_t pg, |
1066 | vector<int> *osds, | |
1067 | ps_t *ppps) const; | |
1068 | int _pick_primary(const vector<int>& osds) const; | |
1069 | void _remove_nonexistent_osds(const pg_pool_t& pool, vector<int>& osds) const; | |
1070 | ||
1071 | void _apply_primary_affinity(ps_t seed, const pg_pool_t& pool, | |
1072 | vector<int> *osds, int *primary) const; | |
1073 | ||
1074 | /// apply pg_upmap[_items] mappings | |
224ce89b | 1075 | void _apply_upmap(const pg_pool_t& pi, pg_t pg, vector<int> *raw) const; |
7c673cae FG |
1076 | |
1077 | /// pg -> (up osd list) | |
1078 | void _raw_to_up_osds(const pg_pool_t& pool, const vector<int>& raw, | |
1079 | vector<int> *up) const; | |
1080 | ||
1081 | ||
1082 | /** | |
1083 | * Get the pg and primary temp, if they are specified. | |
1084 | * @param temp_pg [out] Will be empty or contain the temp PG mapping on return | |
1085 | * @param temp_primary [out] Will be the value in primary_temp, or a value derived | |
1086 | * from the pg_temp (if specified), or -1 if you should use the calculated (up_)primary. | |
1087 | */ | |
1088 | void _get_temp_osds(const pg_pool_t& pool, pg_t pg, | |
1089 | vector<int> *temp_pg, int *temp_primary) const; | |
1090 | ||
1091 | /** | |
1092 | * map to up and acting. Fills in whatever fields are non-NULL. | |
1093 | */ | |
1094 | void _pg_to_up_acting_osds(const pg_t& pg, vector<int> *up, int *up_primary, | |
1095 | vector<int> *acting, int *acting_primary, | |
1096 | bool raw_pg_to_pg = true) const; | |
1097 | ||
1098 | public: | |
1099 | /*** | |
1100 | * This is suitable only for looking at raw CRUSH outputs. It skips | |
1101 | * applying the temp and up checks and should not be used | |
1102 | * by anybody for data mapping purposes. | |
1103 | * raw and primary must be non-NULL | |
1104 | */ | |
31f18b77 | 1105 | void pg_to_raw_osds(pg_t pg, vector<int> *raw, int *primary) const; |
7c673cae | 1106 | /// map a pg to its acting set. @return acting set size |
31f18b77 | 1107 | void pg_to_acting_osds(const pg_t& pg, vector<int> *acting, |
7c673cae FG |
1108 | int *acting_primary) const { |
1109 | _pg_to_up_acting_osds(pg, NULL, NULL, acting, acting_primary); | |
7c673cae | 1110 | } |
31f18b77 | 1111 | void pg_to_acting_osds(pg_t pg, vector<int>& acting) const { |
7c673cae FG |
1112 | return pg_to_acting_osds(pg, &acting, NULL); |
1113 | } | |
1114 | /** | |
1115 | * This does not apply temp overrides and should not be used | |
1116 | * by anybody for data mapping purposes. Specify both pointers. | |
1117 | */ | |
1118 | void pg_to_raw_up(pg_t pg, vector<int> *up, int *primary) const; | |
1119 | /** | |
1120 | * map a pg to its acting set as well as its up set. You must use | |
1121 | * the acting set for data mapping purposes, but some users will | |
1122 | * also find the up set useful for things like deciding what to | |
1123 | * set as pg_temp. | |
1124 | * Each of these pointers must be non-NULL. | |
1125 | */ | |
1126 | void pg_to_up_acting_osds(pg_t pg, vector<int> *up, int *up_primary, | |
1127 | vector<int> *acting, int *acting_primary) const { | |
1128 | _pg_to_up_acting_osds(pg, up, up_primary, acting, acting_primary); | |
1129 | } | |
1130 | void pg_to_up_acting_osds(pg_t pg, vector<int>& up, vector<int>& acting) const { | |
1131 | int up_primary, acting_primary; | |
1132 | pg_to_up_acting_osds(pg, &up, &up_primary, &acting, &acting_primary); | |
1133 | } | |
1134 | bool pg_is_ec(pg_t pg) const { | |
1135 | auto i = pools.find(pg.pool()); | |
1136 | assert(i != pools.end()); | |
1137 | return i->second.ec_pool(); | |
1138 | } | |
1139 | bool get_primary_shard(const pg_t& pgid, spg_t *out) const { | |
1140 | auto i = get_pools().find(pgid.pool()); | |
1141 | if (i == get_pools().end()) { | |
1142 | return false; | |
1143 | } | |
1144 | if (!i->second.ec_pool()) { | |
1145 | *out = spg_t(pgid); | |
1146 | return true; | |
1147 | } | |
1148 | int primary; | |
1149 | vector<int> acting; | |
1150 | pg_to_acting_osds(pgid, &acting, &primary); | |
1151 | for (uint8_t i = 0; i < acting.size(); ++i) { | |
1152 | if (acting[i] == primary) { | |
1153 | *out = spg_t(pgid, shard_id_t(i)); | |
1154 | return true; | |
1155 | } | |
1156 | } | |
1157 | return false; | |
1158 | } | |
1159 | ||
1160 | int64_t lookup_pg_pool_name(const string& name) const { | |
1161 | auto p = name_pool.find(name); | |
1162 | if (p == name_pool.end()) | |
1163 | return -ENOENT; | |
1164 | return p->second; | |
1165 | } | |
1166 | ||
1167 | int64_t get_pool_max() const { | |
1168 | return pool_max; | |
1169 | } | |
1170 | const mempool::osdmap::map<int64_t,pg_pool_t>& get_pools() const { | |
1171 | return pools; | |
1172 | } | |
1173 | mempool::osdmap::map<int64_t,pg_pool_t>& get_pools() { | |
1174 | return pools; | |
1175 | } | |
3efd9988 FG |
1176 | void get_pool_ids_by_rule(int rule_id, set<int64_t> *pool_ids) const { |
1177 | assert(pool_ids); | |
1178 | for (auto &p: pools) { | |
1179 | if ((int)p.second.get_crush_rule() == rule_id) { | |
1180 | pool_ids->insert(p.first); | |
1181 | } | |
1182 | } | |
1183 | } | |
1184 | void get_pool_ids_by_osd(CephContext *cct, | |
1185 | int osd, | |
1186 | set<int64_t> *pool_ids) const; | |
7c673cae FG |
1187 | const string& get_pool_name(int64_t p) const { |
1188 | auto i = pool_name.find(p); | |
1189 | assert(i != pool_name.end()); | |
1190 | return i->second; | |
1191 | } | |
c07f9fc5 FG |
1192 | const mempool::osdmap::map<int64_t,string>& get_pool_names() const { |
1193 | return pool_name; | |
1194 | } | |
7c673cae FG |
1195 | bool have_pg_pool(int64_t p) const { |
1196 | return pools.count(p); | |
1197 | } | |
1198 | const pg_pool_t* get_pg_pool(int64_t p) const { | |
1199 | auto i = pools.find(p); | |
1200 | if (i != pools.end()) | |
1201 | return &i->second; | |
1202 | return NULL; | |
1203 | } | |
1204 | unsigned get_pg_size(pg_t pg) const { | |
1205 | auto p = pools.find(pg.pool()); | |
1206 | assert(p != pools.end()); | |
1207 | return p->second.get_size(); | |
1208 | } | |
1209 | int get_pg_type(pg_t pg) const { | |
1210 | auto p = pools.find(pg.pool()); | |
1211 | assert(p != pools.end()); | |
1212 | return p->second.get_type(); | |
1213 | } | |
1214 | ||
1215 | ||
1216 | pg_t raw_pg_to_pg(pg_t pg) const { | |
1217 | auto p = pools.find(pg.pool()); | |
1218 | assert(p != pools.end()); | |
1219 | return p->second.raw_pg_to_pg(pg); | |
1220 | } | |
1221 | ||
1222 | // pg -> acting primary osd | |
1223 | int get_pg_acting_primary(pg_t pg) const { | |
1224 | int primary = -1; | |
1225 | _pg_to_up_acting_osds(pg, nullptr, nullptr, nullptr, &primary); | |
1226 | return primary; | |
1227 | } | |
1228 | ||
1229 | /* | |
1230 | * check whether an spg_t maps to a particular osd | |
1231 | */ | |
1232 | bool is_up_acting_osd_shard(spg_t pg, int osd) const { | |
1233 | vector<int> up, acting; | |
1234 | _pg_to_up_acting_osds(pg.pgid, &up, NULL, &acting, NULL, false); | |
1235 | if (pg.shard == shard_id_t::NO_SHARD) { | |
1236 | if (calc_pg_role(osd, acting, acting.size()) >= 0 || | |
1237 | calc_pg_role(osd, up, up.size()) >= 0) | |
1238 | return true; | |
1239 | } else { | |
1240 | if (pg.shard < (int)acting.size() && acting[pg.shard] == osd) | |
1241 | return true; | |
1242 | if (pg.shard < (int)up.size() && up[pg.shard] == osd) | |
1243 | return true; | |
1244 | } | |
1245 | return false; | |
1246 | } | |
1247 | ||
1248 | ||
1249 | /* what replica # is a given osd? 0 primary, -1 for none. */ | |
1250 | static int calc_pg_rank(int osd, const vector<int>& acting, int nrep=0); | |
1251 | static int calc_pg_role(int osd, const vector<int>& acting, int nrep=0); | |
1252 | static bool primary_changed( | |
1253 | int oldprimary, | |
1254 | const vector<int> &oldacting, | |
1255 | int newprimary, | |
1256 | const vector<int> &newacting); | |
1257 | ||
1258 | /* rank is -1 (stray), 0 (primary), 1,2,3,... (replica) */ | |
1259 | int get_pg_acting_rank(pg_t pg, int osd) const { | |
1260 | vector<int> group; | |
31f18b77 FG |
1261 | pg_to_acting_osds(pg, group); |
1262 | return calc_pg_rank(osd, group, group.size()); | |
7c673cae FG |
1263 | } |
1264 | /* role is -1 (stray), 0 (primary), 1 (replica) */ | |
1265 | int get_pg_acting_role(const pg_t& pg, int osd) const { | |
1266 | vector<int> group; | |
31f18b77 FG |
1267 | pg_to_acting_osds(pg, group); |
1268 | return calc_pg_role(osd, group, group.size()); | |
7c673cae FG |
1269 | } |
1270 | ||
1271 | bool osd_is_valid_op_target(pg_t pg, int osd) const { | |
1272 | int primary; | |
1273 | vector<int> group; | |
31f18b77 | 1274 | pg_to_acting_osds(pg, &group, &primary); |
7c673cae FG |
1275 | if (osd == primary) |
1276 | return true; | |
1277 | if (pg_is_ec(pg)) | |
1278 | return false; | |
1279 | ||
31f18b77 | 1280 | return calc_pg_role(osd, group, group.size()) >= 0; |
7c673cae FG |
1281 | } |
1282 | ||
1283 | int clean_pg_upmaps( | |
1284 | CephContext *cct, | |
1285 | Incremental *pending_inc); | |
1286 | ||
1287 | bool try_pg_upmap( | |
1288 | CephContext *cct, | |
1289 | pg_t pg, ///< pg to potentially remap | |
1290 | const set<int>& overfull, ///< osds we'd want to evacuate | |
1291 | const vector<int>& underfull, ///< osds to move to, in order of preference | |
1292 | vector<int> *orig, | |
1293 | vector<int> *out); ///< resulting alternative mapping | |
1294 | ||
1295 | int calc_pg_upmaps( | |
1296 | CephContext *cct, | |
1297 | float max_deviation, ///< max deviation from target (value < 1.0) | |
1298 | int max_iterations, ///< max iterations to run | |
1299 | const set<int64_t>& pools, ///< [optional] restrict to pool | |
1300 | Incremental *pending_inc | |
1301 | ); | |
1302 | ||
31f18b77 FG |
1303 | int get_osds_by_bucket_name(const string &name, set<int> *osds) const; |
1304 | ||
7c673cae FG |
1305 | /* |
1306 | * handy helpers to build simple maps... | |
1307 | */ | |
1308 | /** | |
1309 | * Build an OSD map suitable for basic usage. If **num_osd** is >= 0 | |
1310 | * it will be initialized with the specified number of OSDs in a | |
1311 | * single host. If **num_osd** is < 0 the layout of the OSD map will | |
1312 | * be built by reading the content of the configuration file. | |
1313 | * | |
1314 | * @param cct [in] in core ceph context | |
1315 | * @param e [in] initial epoch | |
1316 | * @param fsid [in] id of the cluster | |
1317 | * @param num_osd [in] number of OSDs if >= 0 or read from conf if < 0 | |
1318 | * @return **0** on success, negative errno on error. | |
1319 | */ | |
224ce89b WB |
1320 | private: |
1321 | int build_simple_optioned(CephContext *cct, epoch_t e, uuid_d &fsid, | |
1322 | int num_osd, int pg_bits, int pgp_bits, | |
1323 | bool default_pool); | |
1324 | public: | |
7c673cae | 1325 | int build_simple(CephContext *cct, epoch_t e, uuid_d &fsid, |
224ce89b WB |
1326 | int num_osd) { |
1327 | return build_simple_optioned(cct, e, fsid, num_osd, 0, 0, false); | |
1328 | } | |
1329 | int build_simple_with_pool(CephContext *cct, epoch_t e, uuid_d &fsid, | |
1330 | int num_osd, int pg_bits, int pgp_bits) { | |
1331 | return build_simple_optioned(cct, e, fsid, num_osd, | |
1332 | pg_bits, pgp_bits, true); | |
1333 | } | |
7c673cae FG |
1334 | static int _build_crush_types(CrushWrapper& crush); |
1335 | static int build_simple_crush_map(CephContext *cct, CrushWrapper& crush, | |
1336 | int num_osd, ostream *ss); | |
1337 | static int build_simple_crush_map_from_conf(CephContext *cct, | |
1338 | CrushWrapper& crush, | |
1339 | ostream *ss); | |
31f18b77 FG |
1340 | static int build_simple_crush_rules( |
1341 | CephContext *cct, CrushWrapper& crush, | |
1342 | const string& root, | |
1343 | ostream *ss); | |
7c673cae | 1344 | |
3efd9988 FG |
1345 | bool crush_rule_in_use(int rule_id) const; |
1346 | ||
1347 | int validate_crush_rules(CrushWrapper *crush, ostream *ss) const; | |
7c673cae FG |
1348 | |
1349 | void clear_temp() { | |
1350 | pg_temp->clear(); | |
1351 | primary_temp->clear(); | |
1352 | } | |
1353 | ||
1354 | private: | |
1355 | void print_osd_line(int cur, ostream *out, Formatter *f) const; | |
1356 | public: | |
1357 | void print(ostream& out) const; | |
1358 | void print_pools(ostream& out) const; | |
224ce89b | 1359 | void print_summary(Formatter *f, ostream& out, const string& prefix) const; |
7c673cae | 1360 | void print_oneline_summary(ostream& out) const; |
31f18b77 FG |
1361 | |
1362 | enum { | |
c07f9fc5 FG |
1363 | DUMP_IN = 1, // only 'in' osds |
1364 | DUMP_OUT = 2, // only 'out' osds | |
1365 | DUMP_UP = 4, // only 'up' osds | |
1366 | DUMP_DOWN = 8, // only 'down' osds | |
1367 | DUMP_DESTROYED = 16, // only 'destroyed' osds | |
31f18b77 FG |
1368 | }; |
1369 | void print_tree(Formatter *f, ostream *out, unsigned dump_flags=0) const; | |
7c673cae FG |
1370 | |
1371 | int summarize_mapping_stats( | |
1372 | OSDMap *newmap, | |
1373 | const set<int64_t> *pools, | |
1374 | std::string *out, | |
1375 | Formatter *f) const; | |
1376 | ||
1377 | string get_flag_string() const; | |
1378 | static string get_flag_string(unsigned flags); | |
1379 | static void dump_erasure_code_profiles( | |
1380 | const mempool::osdmap::map<string,map<string,string> > &profiles, | |
1381 | Formatter *f); | |
1382 | void dump(Formatter *f) const; | |
1383 | static void generate_test_instances(list<OSDMap*>& o); | |
1384 | bool check_new_blacklist_entries() const { return new_blacklist_entries; } | |
224ce89b WB |
1385 | |
1386 | void check_health(health_check_map_t *checks) const; | |
35e4c445 FG |
1387 | |
1388 | int parse_osd_id_list(const vector<string>& ls, | |
1389 | set<int> *out, | |
1390 | ostream *ss) const; | |
7c673cae FG |
1391 | }; |
1392 | WRITE_CLASS_ENCODER_FEATURES(OSDMap) | |
1393 | WRITE_CLASS_ENCODER_FEATURES(OSDMap::Incremental) | |
1394 | ||
1395 | typedef ceph::shared_ptr<const OSDMap> OSDMapRef; | |
1396 | ||
1397 | inline ostream& operator<<(ostream& out, const OSDMap& m) { | |
1398 | m.print_oneline_summary(out); | |
1399 | return out; | |
1400 | } | |
1401 | ||
31f18b77 FG |
1402 | class PGStatService; |
1403 | ||
1404 | void print_osd_utilization(const OSDMap& osdmap, | |
1405 | const PGStatService *pgstat, | |
1406 | ostream& out, | |
1407 | Formatter *f, | |
1408 | bool tree); | |
7c673cae FG |
1409 | |
1410 | #endif |