]>
Commit | Line | Data |
---|---|---|
1 | #------------------------------------------------------------------------------\r | |
2 | #\r | |
3 | # Copyright (c) 2014 - 2015, Intel Corporation. All rights reserved.<BR>\r | |
4 | # This program and the accompanying materials\r | |
5 | # are licensed and made available under the terms and conditions of the BSD License\r | |
6 | # which accompanies this distribution. The full text of the license may be found at\r | |
7 | # http://opensource.org/licenses/bsd-license.php.\r | |
8 | #\r | |
9 | # THE PROGRAM IS DISTRIBUTED UNDER THE BSD LICENSE ON AN "AS IS" BASIS,\r | |
10 | # WITHOUT WARRANTIES OR REPRESENTATIONS OF ANY KIND, EITHER EXPRESS OR IMPLIED.\r | |
11 | #\r | |
12 | # Abstract:\r | |
13 | #\r | |
14 | # Provide FSP API entry points.\r | |
15 | #\r | |
16 | #------------------------------------------------------------------------------\r | |
17 | \r | |
18 | \r | |
19 | .equ MSR_IA32_PLATFORM_ID, 0x00000017\r | |
20 | .equ MSR_IA32_BIOS_UPDT_TRIG, 0x00000079\r | |
21 | .equ MSR_IA32_BIOS_SIGN_ID, 0x0000008b\r | |
22 | \r | |
23 | \r | |
24 | MicrocodeHdr:\r | |
25 | .equ MicrocodeHdrVersion, 0x0000\r | |
26 | .equ MicrocodeHdrRevision, 0x0004\r | |
27 | .equ MicrocodeHdrDate, 0x0008\r | |
28 | .equ MicrocodeHdrProcessor, 0x000c\r | |
29 | .equ MicrocodeHdrChecksum, 0x0010\r | |
30 | .equ MicrocodeHdrLoader, 0x0014\r | |
31 | .equ MicrocodeHdrFlags, 0x0018\r | |
32 | .equ MicrocodeHdrDataSize, 0x001C\r | |
33 | .equ MicrocodeHdrTotalSize, 0x0020\r | |
34 | .equ MicrocodeHdrRsvd, 0x0024\r | |
35 | MicrocodeHdrEnd:\r | |
36 | .equ MicrocodeHdrLength, 0x0030 # MicrocodeHdrLength = MicrocodeHdrEnd - MicrocodeHdr\r | |
37 | \r | |
38 | \r | |
39 | ExtSigHdr:\r | |
40 | .equ ExtSigHdrCount, 0x0000\r | |
41 | .equ ExtSigHdrChecksum, 0x0004\r | |
42 | .equ ExtSigHdrRsvd, 0x0008\r | |
43 | ExtSigHdrEnd:\r | |
44 | .equ ExtSigHdrLength, 0x0014 #ExtSigHdrLength = ExtSigHdrEnd - ExtSigHdr\r | |
45 | \r | |
46 | ExtSig:\r | |
47 | .equ ExtSigProcessor, 0x0000\r | |
48 | .equ ExtSigFlags, 0x0004\r | |
49 | .equ ExtSigChecksum, 0x0008\r | |
50 | ExtSigEnd:\r | |
51 | .equ ExtSigLength, 0x000C #ExtSigLength = ExtSigEnd - ExtSig\r | |
52 | \r | |
53 | LoadMicrocodeParams:\r | |
54 | .equ MicrocodeCodeAddr, 0x0000\r | |
55 | .equ MicrocodeCodeSize, 0x0004\r | |
56 | LoadMicrocodeParamsEnd:\r | |
57 | \r | |
58 | \r | |
59 | \r | |
60 | .macro SAVE_REGS\r | |
61 | pinsrw $0x00, %ebp, %xmm7\r | |
62 | ror $0x10, %ebp\r | |
63 | pinsrw $0x01, %ebp, %xmm7\r | |
64 | ror $0x10, %ebp\r | |
65 | #\r | |
66 | pinsrw $0x02, %ebx, %xmm7\r | |
67 | ror $0x10, %ebx\r | |
68 | pinsrw $0x03, %ebx, %xmm7\r | |
69 | ror $0x10, %ebx\r | |
70 | #\r | |
71 | pinsrw $0x04, %esi, %xmm7\r | |
72 | ror $0x10, %esi\r | |
73 | pinsrw $0x05, %esi, %xmm7\r | |
74 | ror $0x10, %esi\r | |
75 | #\r | |
76 | pinsrw $0x06, %edi, %xmm7\r | |
77 | ror $0x10, %edi\r | |
78 | pinsrw $0x07, %edi, %xmm7\r | |
79 | ror $0x10, %edi\r | |
80 | #\r | |
81 | pinsrw $0x00, %esp, %xmm6\r | |
82 | ror $0x10, %esp\r | |
83 | pinsrw $0x01, %esp, %xmm6\r | |
84 | ror $0x10, %esp\r | |
85 | .endm\r | |
86 | \r | |
87 | .macro LOAD_REGS\r | |
88 | pshufd $0xe4, %xmm7, %xmm7\r | |
89 | movd %xmm7, %ebp \r | |
90 | pshufd $0xe4, %xmm7, %xmm7\r | |
91 | #\r | |
92 | pshufd $0x39, %xmm7, %xmm7\r | |
93 | movd %xmm7, %ebx\r | |
94 | pshufd $0x93, %xmm7, %xmm7\r | |
95 | #\r | |
96 | pshufd $0x4e, %xmm7, %xmm7\r | |
97 | movd %xmm7, %esi\r | |
98 | pshufd $0x4e, %xmm7, %xmm7\r | |
99 | #\r | |
100 | pshufd $0x93, %xmm7, %xmm7\r | |
101 | movd %xmm7, %edi\r | |
102 | pshufd $0x39, %xmm7, %xmm7\r | |
103 | #\r | |
104 | movd %xmm6, %esp\r | |
105 | .endm\r | |
106 | \r | |
107 | .macro LOAD_EAX\r | |
108 | pshufd $0x39, %xmm6, %xmm6\r | |
109 | movd %xmm6, %eax\r | |
110 | pshufd $0x93, %xmm6, %xmm6\r | |
111 | .endm\r | |
112 | \r | |
113 | .macro LOAD_EDX\r | |
114 | pshufd $0xe4, %xmm6, %xmm6\r | |
115 | movd %xmm6, %edx\r | |
116 | pshufd $0xe4, %xmm6, %xmm6\r | |
117 | .endm\r | |
118 | \r | |
119 | .macro SAVE_EAX\r | |
120 | pinsrw $0x02, %eax, %xmm6\r | |
121 | ror $0x10, %eax\r | |
122 | pinsrw $0x03, %eax, %xmm6\r | |
123 | ror $0x10, %eax\r | |
124 | .endm\r | |
125 | \r | |
126 | .macro SAVE_EDX\r | |
127 | pinsrw $0x04, %edx, %xmm6\r | |
128 | ror $0x10, %edx\r | |
129 | pinsrw $0x05, %edx, %xmm6\r | |
130 | ror $0x10, %edx\r | |
131 | .endm\r | |
132 | \r | |
133 | .macro LOAD_ESP\r | |
134 | movd %xmm6, %esp\r | |
135 | .endm\r | |
136 | \r | |
137 | .macro ENABLE_SSE\r | |
138 | jmp NextAddress\r | |
139 | .align 4\r | |
140 | #\r | |
141 | # Float control word initial value:\r | |
142 | # all exceptions masked, double-precision, round-to-nearest\r | |
143 | #\r | |
144 | ASM_PFX(mFpuControlWord): .word 0x027F\r | |
145 | #\r | |
146 | # Multimedia-extensions control word:\r | |
147 | # all exceptions masked, round-to-nearest, flush to zero for masked underflow\r | |
148 | #\r | |
149 | ASM_PFX(mMmxControlWord): .long 0x01F80\r | |
150 | SseError: \r | |
151 | #\r | |
152 | # Processor has to support SSE\r | |
153 | #\r | |
154 | jmp SseError \r | |
155 | NextAddress: \r | |
156 | #\r | |
157 | # Initialize floating point units\r | |
158 | #\r | |
159 | finit\r | |
160 | fldcw ASM_PFX(mFpuControlWord)\r | |
161 | \r | |
162 | #\r | |
163 | # Use CpuId instructuion (CPUID.01H:EDX.SSE[bit 25] = 1) to test\r | |
164 | # whether the processor supports SSE instruction.\r | |
165 | #\r | |
166 | movl $1, %eax\r | |
167 | cpuid\r | |
168 | btl $25, %edx\r | |
169 | jnc SseError\r | |
170 | \r | |
171 | #\r | |
172 | # Set OSFXSR bit (bit #9) & OSXMMEXCPT bit (bit #10)\r | |
173 | #\r | |
174 | movl %cr4, %eax\r | |
175 | orl $BIT9, %eax\r | |
176 | movl %eax, %cr4\r | |
177 | \r | |
178 | #\r | |
179 | # The processor should support SSE instruction and we can use\r | |
180 | # ldmxcsr instruction\r | |
181 | #\r | |
182 | ldmxcsr ASM_PFX(mMmxControlWord)\r | |
183 | .endm\r | |
184 | \r | |
185 | #Save in ECX-SLOT 3 in xmm6.\r | |
186 | .macro SAVE_EAX_MICROCODE_RET_STATUS\r | |
187 | pinsrw $0x6, %eax, %xmm6\r | |
188 | ror $0x10, %eax\r | |
189 | pinsrw $0x7, %eax, %xmm6\r | |
190 | rol $0x10, %eax\r | |
191 | .endm\r | |
192 | \r | |
193 | #Restore from ECX-SLOT 3 in xmm6.\r | |
194 | .macro LOAD_EAX_MICROCODE_RET_STATUS\r | |
195 | pshufd $0x93, %xmm6, %xmm6\r | |
196 | movd %xmm6, %eax\r | |
197 | pshufd $0x39, %xmm6, %xmm6\r | |
198 | .endm\r | |
199 | \r | |
200 | \r | |
201 | \r | |
202 | #\r | |
203 | # Following are fixed PCDs\r | |
204 | #\r | |
205 | ASM_GLOBAL ASM_PFX(_gPcd_FixedAtBuild_PcdTemporaryRamBase)\r | |
206 | ASM_GLOBAL ASM_PFX(_gPcd_FixedAtBuild_PcdTemporaryRamSize)\r | |
207 | ASM_GLOBAL ASM_PFX(_gPcd_FixedAtBuild_PcdFspTemporaryRamSize)\r | |
208 | \r | |
209 | #\r | |
210 | # Following functions will be provided in C\r | |
211 | #\r | |
212 | ASM_GLOBAL ASM_PFX(SecStartup)\r | |
213 | ASM_GLOBAL ASM_PFX(FspApiCallingCheck)\r | |
214 | \r | |
215 | #\r | |
216 | # Following functions will be provided in PlatformSecLib\r | |
217 | #\r | |
218 | ASM_GLOBAL ASM_PFX(AsmGetFspBaseAddress)\r | |
219 | ASM_GLOBAL ASM_PFX(AsmGetFspInfoHeader)\r | |
220 | ASM_GLOBAL ASM_PFX(GetBootFirmwareVolumeOffset)\r | |
221 | ASM_GLOBAL ASM_PFX(Loader2PeiSwitchStack)\r | |
222 | \r | |
223 | \r | |
224 | #\r | |
225 | # Define the data length that we saved on the stack top\r | |
226 | #\r | |
227 | .equ DATA_LEN_OF_PER0, 0x018\r | |
228 | .equ DATA_LEN_OF_MCUD, 0x018\r | |
229 | .equ DATA_LEN_AT_STACK_TOP, (DATA_LEN_OF_PER0 + DATA_LEN_OF_MCUD + 4)\r | |
230 | \r | |
231 | #------------------------------------------------------------------------------\r | |
232 | # SecPlatformInitDefault\r | |
233 | # Inputs:\r | |
234 | # mm7 -> Return address\r | |
235 | # Outputs:\r | |
236 | # eax -> 0 - Successful, Non-zero - Failed.\r | |
237 | # Register Usage:\r | |
238 | # eax is cleared and ebp is used for return address.\r | |
239 | # All others reserved.\r | |
240 | #------------------------------------------------------------------------------\r | |
241 | ASM_GLOBAL ASM_PFX(SecPlatformInitDefault)\r | |
242 | ASM_PFX(SecPlatformInitDefault):\r | |
243 | #\r | |
244 | # Save return address to EBP\r | |
245 | #\r | |
246 | movd %mm7, %ebp\r | |
247 | xorl %eax, %eax\r | |
248 | \r | |
249 | SecPlatformInitDefaultExit:\r | |
250 | jmp *%ebp\r | |
251 | \r | |
252 | \r | |
253 | #------------------------------------------------------------------------------\r | |
254 | # LoadMicrocodeDefault\r | |
255 | #\r | |
256 | # Inputs:\r | |
257 | # esp -> LoadMicrocodeParams pointer\r | |
258 | # Register Usage:\r | |
259 | # esp Preserved\r | |
260 | # All others destroyed\r | |
261 | # Assumptions:\r | |
262 | # No memory available, stack is hard-coded and used for return address\r | |
263 | # Executed by SBSP and NBSP\r | |
264 | # Beginning of microcode update region starts on paragraph boundary\r | |
265 | #------------------------------------------------------------------------------\r | |
266 | ASM_GLOBAL ASM_PFX(LoadMicrocodeDefault)\r | |
267 | ASM_PFX(LoadMicrocodeDefault):\r | |
268 | #\r | |
269 | # Save return address to EBP\r | |
270 | #\r | |
271 | movd %mm7, %ebp\r | |
272 | \r | |
273 | cmpl $0x00, %esp\r | |
274 | jz ParamError\r | |
275 | movl 4(%esp), %eax #dword ptr [] Parameter pointer\r | |
276 | cmpl $0x00, %eax\r | |
277 | jz ParamError\r | |
278 | movl %eax, %esp\r | |
279 | movl MicrocodeCodeAddr(%esp), %esi\r | |
280 | cmpl $0x00, %esi\r | |
281 | jnz CheckMainHeader\r | |
282 | \r | |
283 | ParamError:\r | |
284 | movl $0x080000002, %eax\r | |
285 | jmp LoadMicrocodeExit\r | |
286 | \r | |
287 | CheckMainHeader:\r | |
288 | #\r | |
289 | # Get processor signature and platform ID from the installed processor\r | |
290 | # and save into registers for later use\r | |
291 | # ebx = processor signature\r | |
292 | # edx = platform ID\r | |
293 | #\r | |
294 | movl $0x01, %eax\r | |
295 | cpuid\r | |
296 | movl %eax, %ebx\r | |
297 | movl $MSR_IA32_PLATFORM_ID, %ecx\r | |
298 | rdmsr\r | |
299 | movl %edx, %ecx\r | |
300 | shrl $0x12, %ecx #($50-$32)\r | |
301 | andl $0x07, %ecx\r | |
302 | movl $0x01, %edx\r | |
303 | shll %cl,%edx\r | |
304 | \r | |
305 | #\r | |
306 | # Current register usage\r | |
307 | # esp -> stack with paramters\r | |
308 | # esi -> microcode update to check\r | |
309 | # ebx = processor signature\r | |
310 | # edx = platform ID\r | |
311 | #\r | |
312 | \r | |
313 | #\r | |
314 | # Check for valid microcode header\r | |
315 | # Minimal test checking for header version and loader version as 1\r | |
316 | #\r | |
317 | movl $0x01, %eax\r | |
318 | cmpl %eax, MicrocodeHdrVersion(%esi)\r | |
319 | jne AdvanceFixedSize\r | |
320 | cmpl %eax, MicrocodeHdrLoader(%esi)\r | |
321 | jne AdvanceFixedSize\r | |
322 | \r | |
323 | #\r | |
324 | # Check if signature and plaform ID match\r | |
325 | #\r | |
326 | cmpl MicrocodeHdrProcessor(%esi), %ebx\r | |
327 | jne LoadMicrocodeL0\r | |
328 | testl MicrocodeHdrFlags(%esi), %edx\r | |
329 | jnz LoadCheck #Jif signature and platform ID match\r | |
330 | \r | |
331 | LoadMicrocodeL0:\r | |
332 | #\r | |
333 | # Check if extended header exists\r | |
334 | # First check if MicrocodeHdrTotalSize and MicrocodeHdrDataSize are valid\r | |
335 | #\r | |
336 | xorl %eax, %eax\r | |
337 | cmpl %eax, MicrocodeHdrTotalSize(%esi)\r | |
338 | je NextMicrocode\r | |
339 | cmpl %eax, MicrocodeHdrDataSize(%esi)\r | |
340 | je NextMicrocode\r | |
341 | \r | |
342 | #\r | |
343 | # Then verify total size - sizeof header > data size\r | |
344 | #\r | |
345 | movl MicrocodeHdrTotalSize(%esi), %ecx\r | |
346 | subl $MicrocodeHdrLength, %ecx\r | |
347 | cmpl MicrocodeHdrDataSize(%esi), %ecx\r | |
348 | jle NextMicrocode\r | |
349 | \r | |
350 | #\r | |
351 | # Set edi -> extended header\r | |
352 | #\r | |
353 | movl %esi, %edi\r | |
354 | addl $MicrocodeHdrLength, %edi\r | |
355 | addl MicrocodeHdrDataSize(%esi), %edi\r | |
356 | \r | |
357 | #\r | |
358 | # Get count of extended structures\r | |
359 | #\r | |
360 | movl ExtSigHdrCount(%edi), %ecx\r | |
361 | \r | |
362 | #\r | |
363 | # Move pointer to first signature structure\r | |
364 | #\r | |
365 | addl ExtSigHdrLength, %edi\r | |
366 | \r | |
367 | CheckExtSig:\r | |
368 | #\r | |
369 | # Check if extended signature and platform ID match\r | |
370 | #\r | |
371 | cmpl %ebx, ExtSigProcessor(%edi)\r | |
372 | jne LoadMicrocodeL1\r | |
373 | test %edx, ExtSigFlags(%edi)\r | |
374 | jnz LoadCheck # Jif signature and platform ID match\r | |
375 | LoadMicrocodeL1:\r | |
376 | #\r | |
377 | # Check if any more extended signatures exist\r | |
378 | #\r | |
379 | addl $ExtSigLength, %edi\r | |
380 | loop CheckExtSig\r | |
381 | \r | |
382 | NextMicrocode:\r | |
383 | #\r | |
384 | # Advance just after end of this microcode\r | |
385 | #\r | |
386 | xorl %eax, %eax\r | |
387 | cmpl %eax, MicrocodeHdrTotalSize(%esi)\r | |
388 | je LoadMicrocodeL2\r | |
389 | addl MicrocodeHdrTotalSize(%esi), %esi\r | |
390 | jmp CheckAddress\r | |
391 | LoadMicrocodeL2:\r | |
392 | addl $0x800, %esi #add esi, dword ptr 2048\r | |
393 | jmp CheckAddress\r | |
394 | \r | |
395 | AdvanceFixedSize:\r | |
396 | #\r | |
397 | # Advance by 4X dwords\r | |
398 | #\r | |
399 | addl $0x400, %esi #add esi, dword ptr 1024\r | |
400 | \r | |
401 | CheckAddress:\r | |
402 | #\r | |
403 | # Is valid Microcode start point ?\r | |
404 | #\r | |
405 | cmpl $0x0ffffffff, MicrocodeHdrVersion(%esi)\r | |
406 | \r | |
407 | #\r | |
408 | # Is automatic size detection ?\r | |
409 | #\r | |
410 | movl MicrocodeCodeSize(%esp), %eax\r | |
411 | cmpl $0x0ffffffff, %eax\r | |
412 | jz LoadMicrocodeL3\r | |
413 | #\r | |
414 | # Address >= microcode region address + microcode region size?\r | |
415 | #\r | |
416 | addl MicrocodeCodeAddr(%esp), %eax\r | |
417 | \r | |
418 | cmpl %eax, %esi\r | |
419 | jae Done #Jif address is outside of microcode region\r | |
420 | jmp CheckMainHeader\r | |
421 | \r | |
422 | LoadMicrocodeL3:\r | |
423 | LoadCheck:\r | |
424 | #\r | |
425 | # Get the revision of the current microcode update loaded\r | |
426 | #\r | |
427 | movl $MSR_IA32_BIOS_SIGN_ID, %ecx\r | |
428 | xorl %eax, %eax # Clear EAX\r | |
429 | xorl %edx, %edx # Clear EDX\r | |
430 | wrmsr # Load 0 to MSR at 8Bh\r | |
431 | \r | |
432 | movl $0x01, %eax\r | |
433 | cpuid\r | |
434 | movl $MSR_IA32_BIOS_SIGN_ID, %ecx\r | |
435 | rdmsr # Get current microcode signature\r | |
436 | \r | |
437 | #\r | |
438 | # Verify this microcode update is not already loaded\r | |
439 | #\r | |
440 | cmpl %edx, MicrocodeHdrRevision(%esi)\r | |
441 | je Continue\r | |
442 | \r | |
443 | LoadMicrocode0:\r | |
444 | #\r | |
445 | # EAX contains the linear address of the start of the Update Data\r | |
446 | # EDX contains zero\r | |
447 | # ECX contains 79h (IA32_BIOS_UPDT_TRIG)\r | |
448 | # Start microcode load with wrmsr\r | |
449 | #\r | |
450 | movl %esi, %eax\r | |
451 | addl $MicrocodeHdrLength, %eax\r | |
452 | xorl %edx, %edx\r | |
453 | movl $MSR_IA32_BIOS_UPDT_TRIG, %ecx\r | |
454 | wrmsr\r | |
455 | movl $0x01, %eax\r | |
456 | cpuid\r | |
457 | \r | |
458 | Continue:\r | |
459 | jmp NextMicrocode\r | |
460 | \r | |
461 | Done:\r | |
462 | movl $0x01, %eax\r | |
463 | cpuid\r | |
464 | movl $MSR_IA32_BIOS_SIGN_ID, %ecx\r | |
465 | rdmsr # Get current microcode signature\r | |
466 | xorl %eax, %eax\r | |
467 | cmpl $0x00, %edx\r | |
468 | jnz LoadMicrocodeExit\r | |
469 | movl $0x08000000E, %eax\r | |
470 | \r | |
471 | LoadMicrocodeExit:\r | |
472 | jmp *%ebp\r | |
473 | \r | |
474 | \r | |
475 | #----------------------------------------------------------------------------\r | |
476 | # EstablishStackFsp\r | |
477 | #\r | |
478 | #----------------------------------------------------------------------------\r | |
479 | ASM_GLOBAL ASM_PFX(EstablishStackFsp)\r | |
480 | ASM_PFX(EstablishStackFsp):\r | |
481 | #\r | |
482 | # Save parameter pointer in edx\r | |
483 | #\r | |
484 | movl 4(%esp), %edx\r | |
485 | \r | |
486 | #\r | |
487 | # Enable FSP STACK\r | |
488 | #\r | |
489 | movl PcdGet32(PcdTemporaryRamBase), %esp\r | |
490 | addl PcdGet32(PcdTemporaryRamSize), %esp\r | |
491 | \r | |
492 | pushl $DATA_LEN_OF_MCUD # Size of the data region\r | |
493 | pushl $0x4455434D # Signature of the data region 'MCUD'\r | |
494 | pushl 12(%edx) # Code size\r | |
495 | pushl 8(%edx) # Code base\r | |
496 | pushl 4(%edx) # Microcode size\r | |
497 | pushl (%edx) # Microcode base\r | |
498 | \r | |
499 | #\r | |
500 | # Save API entry/exit timestamp into stack\r | |
501 | #\r | |
502 | pushl $DATA_LEN_OF_PER0 # Size of the data region\r | |
503 | pushl $0x30524550 # Signature of the data region 'PER0'\r | |
504 | LOAD_EDX\r | |
505 | pushl %edx\r | |
506 | LOAD_EAX\r | |
507 | pushl %eax\r | |
508 | rdtsc\r | |
509 | pushl %edx\r | |
510 | pushl %eax\r | |
511 | \r | |
512 | #\r | |
513 | # Terminator for the data on stack\r | |
514 | #\r | |
515 | push $0x00\r | |
516 | \r | |
517 | #\r | |
518 | # Set ECX/EDX to the BootLoader temporary memory range\r | |
519 | #\r | |
520 | movl PcdGet32 (PcdTemporaryRamBase), %ecx\r | |
521 | movl %ecx, %edx\r | |
522 | addl PcdGet32 (PcdTemporaryRamSize), %edx\r | |
523 | subl PcdGet32 (PcdFspTemporaryRamSize), %edx\r | |
524 | \r | |
525 | xorl %eax, %eax\r | |
526 | \r | |
527 | movd %mm7, %esi #RET_ESI\r | |
528 | jmp *%esi\r | |
529 | \r | |
530 | #----------------------------------------------------------------------------\r | |
531 | # TempRamInit API\r | |
532 | #\r | |
533 | # This FSP API will load the microcode update, enable code caching for the\r | |
534 | # region specified by the boot loader and also setup a temporary stack to be\r | |
535 | # used till main memory is initialized.\r | |
536 | #\r | |
537 | #----------------------------------------------------------------------------\r | |
538 | ASM_GLOBAL ASM_PFX(TempRamInitApi)\r | |
539 | ASM_PFX(TempRamInitApi):\r | |
540 | #\r | |
541 | # Ensure SSE is enabled\r | |
542 | #\r | |
543 | ENABLE_SSE\r | |
544 | \r | |
545 | #\r | |
546 | # Save EBP, EBX, ESI, EDI & ESP in XMM7 & XMM6\r | |
547 | #\r | |
548 | SAVE_REGS\r | |
549 | \r | |
550 | #\r | |
551 | # Save timestamp into XMM6\r | |
552 | #\r | |
553 | rdtsc\r | |
554 | SAVE_EAX\r | |
555 | SAVE_EDX\r | |
556 | \r | |
557 | #\r | |
558 | # Check Parameter\r | |
559 | #\r | |
560 | movl 4(%esp), %eax\r | |
561 | cmpl $0x00, %eax\r | |
562 | movl $0x80000002, %eax\r | |
563 | jz NemInitExit\r | |
564 | \r | |
565 | #\r | |
566 | # Sec Platform Init\r | |
567 | #\r | |
568 | movl $TempRamInitApiL1, %esi #CALL_MMX SecPlatformInit\r | |
569 | movd %esi, %mm7\r | |
570 | .weak ASM_PFX(SecPlatformInit)\r | |
571 | .set ASM_PFX(SecPlatformInit), ASM_PFX(SecPlatformInitDefault)\r | |
572 | jmp ASM_PFX(SecPlatformInit)\r | |
573 | TempRamInitApiL1:\r | |
574 | cmpl $0x00, %eax\r | |
575 | jnz NemInitExit\r | |
576 | \r | |
577 | #\r | |
578 | # Load microcode\r | |
579 | #\r | |
580 | LOAD_ESP\r | |
581 | movl $TempRamInitApiL2, %esi #CALL_MMX LoadMicrocode\r | |
582 | movd %esi, %mm7\r | |
583 | .weak ASM_PFX(LoadMicrocode)\r | |
584 | .set ASM_PFX(LoadMicrocode), ASM_PFX(LoadMicrocodeDefault)\r | |
585 | jmp ASM_PFX(LoadMicrocode)\r | |
586 | TempRamInitApiL2:\r | |
587 | SAVE_EAX_MICROCODE_RET_STATUS #Save microcode return status in ECX-SLOT 3 in xmm6.\r | |
588 | #@note If return value eax is not 0, microcode did not load, but continue and attempt to boot from ECX-SLOT 3 in xmm6.\r | |
589 | \r | |
590 | #\r | |
591 | # Call Sec CAR Init\r | |
592 | #\r | |
593 | LOAD_ESP\r | |
594 | movl $TempRamInitApiL3, %esi #CALL_MMX SecCarInit\r | |
595 | movd %esi, %mm7\r | |
596 | jmp ASM_PFX(SecCarInit)\r | |
597 | TempRamInitApiL3:\r | |
598 | cmpl $0x00, %eax\r | |
599 | jnz NemInitExit\r | |
600 | \r | |
601 | #\r | |
602 | # EstablishStackFsp\r | |
603 | #\r | |
604 | LOAD_ESP\r | |
605 | movl $TempRamInitApiL4, %esi #CALL_MMX EstablishStackFsp\r | |
606 | movd %esi, %mm7\r | |
607 | jmp ASM_PFX(EstablishStackFsp)\r | |
608 | TempRamInitApiL4:\r | |
609 | \r | |
610 | LOAD_EAX_MICROCODE_RET_STATUS #Restore microcode status if no CAR init error.\r | |
611 | \r | |
612 | NemInitExit:\r | |
613 | #\r | |
614 | # Load EBP, EBX, ESI, EDI & ESP from XMM7 & XMM6\r | |
615 | #\r | |
616 | LOAD_REGS\r | |
617 | ret\r | |
618 | \r | |
619 | \r | |
620 | #----------------------------------------------------------------------------\r | |
621 | # FspInit API\r | |
622 | #\r | |
623 | # This FSP API will perform the processor and chipset initialization.\r | |
624 | # This API will not return. Instead, it transfers the control to the\r | |
625 | # ContinuationFunc provided in the parameter.\r | |
626 | #\r | |
627 | #----------------------------------------------------------------------------\r | |
628 | ASM_GLOBAL ASM_PFX(FspInitApi)\r | |
629 | ASM_PFX(FspInitApi):\r | |
630 | movl $0x01, %eax\r | |
631 | jmp FspApiCommon\r | |
632 | \r | |
633 | #----------------------------------------------------------------------------\r | |
634 | # NotifyPhase API\r | |
635 | #\r | |
636 | # This FSP API will notify the FSP about the different phases in the boot\r | |
637 | # process\r | |
638 | #\r | |
639 | #----------------------------------------------------------------------------\r | |
640 | ASM_GLOBAL ASM_PFX(NotifyPhaseApi)\r | |
641 | ASM_PFX(NotifyPhaseApi):\r | |
642 | movl $0x02, %eax\r | |
643 | jmp FspApiCommon\r | |
644 | \r | |
645 | #----------------------------------------------------------------------------\r | |
646 | # FspMemoryInit API\r | |
647 | #\r | |
648 | # This FSP API is called after TempRamInit and initializes the memory.\r | |
649 | #\r | |
650 | #----------------------------------------------------------------------------\r | |
651 | ASM_GLOBAL ASM_PFX(FspMemoryInitApi)\r | |
652 | ASM_PFX(FspMemoryInitApi):\r | |
653 | movl $0x03, %eax\r | |
654 | jmp FspApiCommon\r | |
655 | \r | |
656 | #----------------------------------------------------------------------------\r | |
657 | # TempRamExitApi API\r | |
658 | #\r | |
659 | # This API tears down temporary RAM\r | |
660 | #\r | |
661 | #----------------------------------------------------------------------------\r | |
662 | ASM_GLOBAL ASM_PFX(TempRamExitApi)\r | |
663 | ASM_PFX(TempRamExitApi):\r | |
664 | movl $0x04, %eax\r | |
665 | jmp FspApiCommon\r | |
666 | \r | |
667 | #----------------------------------------------------------------------------\r | |
668 | # FspSiliconInit API\r | |
669 | #\r | |
670 | # This FSP API initializes the CPU and the chipset including the IO\r | |
671 | # controllers in the chipset to enable normal operation of these devices.\r | |
672 | #\r | |
673 | #----------------------------------------------------------------------------\r | |
674 | ASM_GLOBAL ASM_PFX(FspSiliconInitApi)\r | |
675 | ASM_PFX(FspSiliconInitApi):\r | |
676 | movl $0x05, %eax\r | |
677 | jmp FspApiCommon\r | |
678 | \r | |
679 | #----------------------------------------------------------------------------\r | |
680 | # FspApiCommon API\r | |
681 | #\r | |
682 | # This is the FSP API common entry point to resume the FSP execution\r | |
683 | #\r | |
684 | #----------------------------------------------------------------------------\r | |
685 | ASM_GLOBAL ASM_PFX(FspApiCommon)\r | |
686 | ASM_PFX(FspApiCommon):\r | |
687 | #\r | |
688 | # EAX holds the API index\r | |
689 | #\r | |
690 | \r | |
691 | #\r | |
692 | # Stack must be ready\r | |
693 | # \r | |
694 | pushl %eax\r | |
695 | addl $0x04, %esp\r | |
696 | cmpl -4(%esp), %eax\r | |
697 | jz FspApiCommonL0\r | |
698 | movl $0x080000003, %eax\r | |
699 | jmp FspApiCommonExit\r | |
700 | \r | |
701 | FspApiCommonL0:\r | |
702 | #\r | |
703 | # Verify the calling condition\r | |
704 | #\r | |
705 | pushal\r | |
706 | pushl %eax\r | |
707 | call ASM_PFX(FspApiCallingCheck)\r | |
708 | addl $0x04, %esp\r | |
709 | cmpl $0x00, %eax\r | |
710 | jz FspApiCommonL1\r | |
711 | movl %eax, 0x1C(%esp) # mov dword ptr [esp + 4 * 7], eax\r | |
712 | popal\r | |
713 | ret\r | |
714 | \r | |
715 | FspApiCommonL1:\r | |
716 | popal\r | |
717 | cmpl $0x01, %eax # FspInit API\r | |
718 | jz FspApiCommonL2\r | |
719 | cmpl $0x03, %eax # FspMemoryInit API\r | |
720 | jz FspApiCommonL2\r | |
721 | call ASM_PFX(AsmGetFspInfoHeader)\r | |
722 | jmp Loader2PeiSwitchStack\r | |
723 | \r | |
724 | FspApiCommonL2:\r | |
725 | #\r | |
726 | # FspInit and FspMemoryInit APIs, setup the initial stack frame\r | |
727 | # \r | |
728 | \r | |
729 | #\r | |
730 | # Place holder to store the FspInfoHeader pointer\r | |
731 | #\r | |
732 | pushl %eax\r | |
733 | \r | |
734 | #\r | |
735 | # Update the FspInfoHeader pointer\r | |
736 | #\r | |
737 | pushl %eax\r | |
738 | call ASM_PFX(AsmGetFspInfoHeader)\r | |
739 | movl %eax, 4(%esp)\r | |
740 | popl %eax\r | |
741 | \r | |
742 | #\r | |
743 | # Create a Task Frame in the stack for the Boot Loader\r | |
744 | #\r | |
745 | pushfl # 2 pushf for 4 byte alignment\r | |
746 | cli\r | |
747 | pushal\r | |
748 | \r | |
749 | #\r | |
750 | # Reserve 8 bytes for IDT save/restore\r | |
751 | #\r | |
752 | subl $0x08, %esp\r | |
753 | sidt (%esp)\r | |
754 | \r | |
755 | #\r | |
756 | # Setup new FSP stack\r | |
757 | #\r | |
758 | movl %esp, %edi\r | |
759 | movl PcdGet32(PcdTemporaryRamBase), %esp\r | |
760 | addl PcdGet32(PcdTemporaryRamSize), %esp\r | |
761 | subl $(DATA_LEN_AT_STACK_TOP + 0x40), %esp\r | |
762 | \r | |
763 | #\r | |
764 | # Pass the API Idx to SecStartup\r | |
765 | #\r | |
766 | pushl %eax\r | |
767 | \r | |
768 | #\r | |
769 | # Pass the BootLoader stack to SecStartup\r | |
770 | #\r | |
771 | pushl %edi\r | |
772 | \r | |
773 | #\r | |
774 | # Pass entry point of the PEI core\r | |
775 | #\r | |
776 | call ASM_PFX(AsmGetFspBaseAddress)\r | |
777 | movl %eax, %edi\r | |
778 | addl PcdGet32(PcdFspAreaSize), %edi\r | |
779 | subl $0x20, %edi\r | |
780 | addl %ds:(%edi), %eax\r | |
781 | pushl %eax\r | |
782 | \r | |
783 | #\r | |
784 | # Pass BFV into the PEI Core\r | |
785 | # It uses relative address to calucate the actual boot FV base\r | |
786 | # For FSP impleantion with single FV, PcdFlashFvRecoveryBase and\r | |
787 | # PcdFspAreaBaseAddress are the same. For FSP with mulitple FVs,\r | |
788 | # they are different. The code below can handle both cases.\r | |
789 | #\r | |
790 | call ASM_PFX(AsmGetFspBaseAddress)\r | |
791 | movl %eax, %edi\r | |
792 | call ASM_PFX(GetBootFirmwareVolumeOffset)\r | |
793 | addl %edi, %eax\r | |
794 | pushl %eax\r | |
795 | \r | |
796 | #\r | |
797 | # Pass stack base and size into the PEI Core\r | |
798 | #\r | |
799 | movl PcdGet32(PcdTemporaryRamBase), %eax\r | |
800 | addl PcdGet32(PcdTemporaryRamSize), %eax\r | |
801 | subl PcdGet32(PcdFspTemporaryRamSize), %eax\r | |
802 | pushl %eax\r | |
803 | pushl PcdGet32(PcdFspTemporaryRamSize)\r | |
804 | \r | |
805 | #\r | |
806 | # Pass Control into the PEI Core\r | |
807 | #\r | |
808 | call ASM_PFX(SecStartup)\r | |
809 | addl $4, %esp\r | |
810 | FspApiCommonExit:\r | |
811 | ret\r | |
812 | \r |