--- /dev/null
+#!/usr/bin/python\r
+## @file\r
+# Firmware Configuration Editor (FCE) from https://firmware.intel.com/develop\r
+# can parse BIOS image and generate Firmware Configuration file.\r
+# This script bases on Firmware Configuration file, and generate the structure\r
+# PCD setting in DEC/DSC/INF files.\r
+#\r
+# Copyright (c) 2018, Intel Corporation. All rights reserved.<BR>\r
+# This program and the accompanying materials\r
+# are licensed and made available under the terms and conditions of the BSD License\r
+# which accompanies this distribution. The full text of the license may be found at\r
+# http://opensource.org/licenses/bsd-license.php\r
+#\r
+# THE PROGRAM IS DISTRIBUTED UNDER THE BSD LICENSE ON AN "AS IS" BASIS,\r
+# WITHOUT WARRANTIES OR REPRESENTATIONS OF ANY KIND, EITHER EXPRESS OR IMPLIED.\r
+#\r
+\r
+'''\r
+ConvertFceToStructurePcd\r
+'''\r
+\r
+import re\r
+import os\r
+import datetime\r
+import argparse\r
+\r
+#\r
+# Globals for help information\r
+#\r
+__prog__ = 'ConvertFceToStructurePcd'\r
+__version__ = '%s Version %s' % (__prog__, '0.1 ')\r
+__copyright__ = 'Copyright (c) 2018, Intel Corporation. All rights reserved.'\r
+__description__ = 'Generate Structure PCD in DEC/DSC/INF based on Firmware Configuration.\n'\r
+\r
+\r
+dscstatement='''[Defines]\r
+ VPD_TOOL_GUID = 8C3D856A-9BE6-468E-850A-24F7A8D38E08\r
+\r
+[SkuIds]\r
+ 0|DEFAULT # The entry: 0|DEFAULT is reserved and always required.\r
+\r
+[DefaultStores]\r
+ 0|STANDARD # UEFI Standard default 0|STANDARD is reserved.\r
+ 1|MANUFACTURING # UEFI Manufacturing default 1|MANUFACTURING is reserved.\r
+\r
+[PcdsDynamicExVpd.common.DEFAULT]\r
+ gEfiMdeModulePkgTokenSpaceGuid.PcdNvStoreDefaultValueBuffer|*\r
+'''\r
+\r
+decstatement = '''[Guids]\r
+ gStructPcdTokenSpaceGuid = {0x3f1406f4, 0x2b, 0x487a, {0x8b, 0x69, 0x74, 0x29, 0x1b, 0x36, 0x16, 0xf4}}\r
+\r
+[PcdsFixedAtBuild,PcdsPatchableInModule,PcdsDynamic,PcdsDynamicEx]\r
+'''\r
+\r
+infstatement = '''[Pcd]\r
+'''\r
+\r
+SECTION='PcdsDynamicHii'\r
+PCD_NAME='gStructPcdTokenSpaceGuid.Pcd'\r
+\r
+WARNING=[]\r
+ERRORMSG=[]\r
+\r
+class parser_lst(object):\r
+\r
+ def __init__(self,filelist):\r
+ self._ignore=['BOOLEAN', 'UINT8', 'UINT16', 'UINT32', 'UINT64']\r
+ self.file=filelist\r
+ self.text=self.megre_lst()[0]\r
+ self.content=self.megre_lst()[1]\r
+\r
+ def megre_lst(self):\r
+ alltext=''\r
+ content={}\r
+ for file in self.file:\r
+ with open(file,'r') as f:\r
+ read =f.read()\r
+ alltext += read\r
+ content[file]=read\r
+ return alltext,content\r
+\r
+ def struct_lst(self):#{struct:lst file}\r
+ structs_file={}\r
+ name_format = re.compile(r'(?<!typedef)\s+struct (\w+) {.*?;', re.S)\r
+ for i in list(self.content.keys()):\r
+ structs= name_format.findall(self.content[i])\r
+ if structs:\r
+ for j in structs:\r
+ if j not in self._ignore:\r
+ structs_file[j]=i\r
+ else:\r
+ print("%s"%structs)\r
+ return structs_file\r
+\r
+ def struct(self):#struct:{offset:name}\r
+ unit_num = re.compile('(\d+)')\r
+ offset1_re = re.compile('(\d+)\[')\r
+ pcdname_num_re = re.compile('\w+\[(\S+)\]')\r
+ pcdname_re = re.compile('\](.*)\<')\r
+ pcdname2_re = re.compile('(\w+)\[')\r
+ uint_re = re.compile('\<(\S+)\>')\r
+ name_format = re.compile(r'(?<!typedef)\s+struct (\w+) {.*?;', re.S)\r
+ name=name_format.findall(self.text)\r
+ info={}\r
+ unparse=[]\r
+ if name:\r
+ tmp_n = [n for n in name if n not in self._ignore]\r
+ name = list(set(tmp_n))\r
+ name.sort(key = tmp_n.index)\r
+ name.reverse()\r
+ #name=list(set(name).difference(set(self._ignore)))\r
+ for struct in name:\r
+ s_re = re.compile(r'struct %s :(.*?)};'% struct, re.S)\r
+ content = s_re.search(self.text)\r
+ if content:\r
+ tmp_dict = {}\r
+ text = content.group().split('+')\r
+ for line in text[1:]:\r
+ offset = offset1_re.findall(line)\r
+ t_name = pcdname_re.findall(line)\r
+ uint = uint_re.findall(line)\r
+ if offset and uint:\r
+ offset = offset[0]\r
+ uint = uint[0]\r
+ if t_name:\r
+ t_name = t_name[0].strip()\r
+ if (' ' in t_name) or ("=" in t_name) or (";" in t_name) or("\\" in name) or (t_name ==''):\r
+ WARNING.append("Warning:Invalid Pcd name '%s' for Offset %s in struct %s" % (t_name,offset, struct))\r
+ else:\r
+ if '[' in t_name:\r
+ if uint in ['UINT8', 'UINT16', 'UINT32', 'UINT64']:\r
+ offset = int(offset, 10)\r
+ tmp_name = pcdname2_re.findall(t_name)[0] + '[0]'\r
+ tmp_dict[offset] = tmp_name\r
+ pcdname_num = int(pcdname_num_re.findall(t_name)[0],10)\r
+ uint = int(unit_num.findall(uint)[0],10)\r
+ bit = uint / 8\r
+ for i in range(1, pcdname_num):\r
+ offset += bit\r
+ tmp_name = pcdname2_re.findall(t_name)[0] + '[%s]' % i\r
+ tmp_dict[offset] = tmp_name\r
+ else:\r
+ tmp_name = pcdname2_re.findall(t_name)[0]\r
+ pcdname_num = pcdname_num_re.findall(t_name)[0]\r
+ line = [offset,tmp_name,pcdname_num,uint]\r
+ line.append(struct)\r
+ unparse.append(line)\r
+ else:\r
+ if uint not in ['UINT8', 'UINT16', 'UINT32', 'UINT64']:\r
+ line = [offset, t_name, 0, uint]\r
+ line.append(struct)\r
+ unparse.append(line)\r
+ else:\r
+ offset = int(offset,10)\r
+ tmp_dict[offset] = t_name\r
+ info[struct] = tmp_dict\r
+ if len(unparse) != 0:\r
+ for u in unparse:\r
+ if u[3] in list(info.keys()):\r
+ unpar = self.nameISstruct(u,info[u[3]])\r
+ info[u[4]]= dict(list(info[u[4]].items())+list(unpar[u[4]].items()))\r
+ else:\r
+ print("ERROR: No struct name found in %s" % self.file)\r
+ ERRORMSG.append("ERROR: No struct name found in %s" % self.file)\r
+ return info\r
+\r
+\r
+ def nameISstruct(self,line,key_dict):\r
+ dict={}\r
+ dict2={}\r
+ s_re = re.compile(r'struct %s :(.*?)};' % line[3], re.S)\r
+ size_re = re.compile(r'mTotalSize \[(\S+)\]')\r
+ content = s_re.search(self.text)\r
+ if content:\r
+ s_size = size_re.findall(content.group())[0]\r
+ else:\r
+ s_size = '0'\r
+ print("ERROR: Struct %s not define mTotalSize in lst file" %line[3])\r
+ ERRORMSG.append("ERROR: Struct %s not define mTotalSize in lst file" %line[3])\r
+ size = int(line[0], 10)\r
+ if line[2] != 0:\r
+ for j in range(0, int(line[2], 10)):\r
+ for k in list(key_dict.keys()):\r
+ offset = size + k\r
+ name ='%s.%s' %((line[1]+'[%s]'%j),key_dict[k])\r
+ dict[offset] = name\r
+ size = int(s_size,16)+size\r
+ elif line[2] == 0:\r
+ for k in list(key_dict.keys()):\r
+ offset = size + k\r
+ name = '%s.%s' % (line[1], key_dict[k])\r
+ dict[offset] = name\r
+ dict2[line[4]] = dict\r
+ return dict2\r
+\r
+ def efivarstore_parser(self):\r
+ efivarstore_format = re.compile(r'efivarstore.*?;', re.S)\r
+ struct_re = re.compile(r'efivarstore(.*?),',re.S)\r
+ name_re = re.compile(r'name=(\w+)')\r
+ efivarstore_dict={}\r
+ efitxt = efivarstore_format.findall(self.text)\r
+ for i in efitxt:\r
+ struct = struct_re.findall(i.replace(' ',''))\r
+ name = name_re.findall(i.replace(' ',''))\r
+ if struct and name:\r
+ efivarstore_dict[name[0]]=struct[0]\r
+ else:\r
+ print("ERROR: Can't find Struct or name in lst file, please check have this format:efivarstore XXXX, name=xxxx")\r
+ ERRORMSG.append("ERROR: Can't find Struct or name in lst file, please check have this format:efivarstore XXXX, name=xxxx")\r
+ return efivarstore_dict\r
+\r
+class Config(object):\r
+\r
+ def __init__(self,Config):\r
+ self.config=Config\r
+\r
+ #Parser .config file,return list[offset,name,guid,value,help]\r
+ def config_parser(self):\r
+ ids_re =re.compile('_ID:(\d+)',re.S)\r
+ id_re= re.compile('\s+')\r
+ info = []\r
+ info_dict={}\r
+ with open(self.config, 'r') as text:\r
+ read = text.read()\r
+ if 'DEFAULT_ID:' in read:\r
+ all_txt = read.split('FCEKEY DEFAULT')\r
+ for i in all_txt[1:]:\r
+ part = [] #save all infomation for DEFAULT_ID\r
+ str_id=''\r
+ ids = ids_re.findall(i.replace(' ',''))\r
+ for m in ids:\r
+ str_id +=m+'_'\r
+ str_id=str_id[:-1]\r
+ part.append(ids)\r
+ section = i.split('\nQ') #split with '\nQ ' to get every block\r
+ part +=self.section_parser(section)\r
+ info_dict[str_id] = self.section_parser(section)\r
+ info.append(part)\r
+ else:\r
+ part = []\r
+ id=('0','0')\r
+ str_id='0_0'\r
+ part.append(id)\r
+ section = read.split('\nQ')\r
+ part +=self.section_parser(section)\r
+ info_dict[str_id] = self.section_parser(section)\r
+ info.append(part)\r
+ return info_dict\r
+\r
+ def eval_id(self,id):\r
+ id = id.split("_")\r
+ default_id=id[0:len(id)//2]\r
+ platform_id=id[len(id)//2:]\r
+ text=''\r
+ for i in range(len(default_id)):\r
+ text +="%s.common.%s.%s,"%(SECTION,self.id_name(platform_id[i],'PLATFORM'),self.id_name(default_id[i],'DEFAULT'))\r
+ return '\n[%s]\n'%text[:-1]\r
+\r
+ def id_name(self,ID, flag):\r
+ platform_dict = {'0': 'DEFAULT'}\r
+ default_dict = {'0': 'STANDARD', '1': 'MANUFACTURING'}\r
+ if flag == "PLATFORM":\r
+ try:\r
+ value = platform_dict[ID]\r
+ except KeyError:\r
+ value = 'SKUID%s' % ID\r
+ elif flag == 'DEFAULT':\r
+ try:\r
+ value = default_dict[ID]\r
+ except KeyError:\r
+ value = 'DEFAULTID%s' % ID\r
+ else:\r
+ value = None\r
+ return value\r
+\r
+ def section_parser(self,section):\r
+ offset_re = re.compile(r'offset=(\w+)')\r
+ name_re = re.compile(r'name=(\S+)')\r
+ guid_re = re.compile(r'guid=(\S+)')\r
+ # help_re = re.compile(r'help = (.*)')\r
+ attribute_re=re.compile(r'attribute=(\w+)')\r
+ value_re = re.compile(r'(//.*)')\r
+ part = []\r
+ for x in section[1:]:\r
+ line=x.split('\n')[0]\r
+ line=value_re.sub('',line) #delete \\... in "Q...." line\r
+ list1=line.split(' ')\r
+ value=self.value_parser(list1)\r
+ offset = offset_re.findall(x.replace(' ',''))\r
+ name = name_re.findall(x.replace(' ',''))\r
+ guid = guid_re.findall(x.replace(' ',''))\r
+ attribute =attribute_re.findall(x.replace(' ',''))\r
+ if offset and name and guid and value and attribute:\r
+ if attribute[0] in ['0x3','0x7']:\r
+ offset = int(offset[0], 16)\r
+ #help = help_re.findall(x)\r
+ text = offset, name[0], guid[0], value, attribute[0]\r
+ part.append(text)\r
+ return(part)\r
+\r
+ def value_parser(self, list1):\r
+ list1 = [t for t in list1 if t != ''] # remove '' form list\r
+ first_num = int(list1[0], 16)\r
+ if list1[first_num + 1] == 'STRING': # parser STRING\r
+ value = 'L%s' % list1[-1]\r
+ elif list1[first_num + 1] == 'ORDERED_LIST': # parser ORDERED_LIST\r
+ value_total = int(list1[first_num + 2])\r
+ list2 = list1[-value_total:]\r
+ tmp = []\r
+ line = ''\r
+ for i in list2:\r
+ if len(i) % 2 == 0 and len(i) != 2:\r
+ for m in range(0, len(i) // 2):\r
+ tmp.append('0x%02x' % (int('0x%s' % i, 16) >> m * 8 & 0xff))\r
+ else:\r
+ tmp.append('0x%s' % i)\r
+ for i in tmp:\r
+ line += '%s,' % i\r
+ value = '{%s}' % line[:-1]\r
+ else:\r
+ value = "0x%01x" % int(list1[-1], 16)\r
+ return value\r
+\r
+\r
+#parser Guid file, get guid name form guid value\r
+class GUID(object):\r
+\r
+ def __init__(self,path):\r
+ self.path = path\r
+ self.guidfile = self.gfile()\r
+ self.guiddict = self.guid_dict()\r
+\r
+ def gfile(self):\r
+ for root, dir, file in os.walk(self.path, topdown=True, followlinks=False):\r
+ if 'FV' in dir:\r
+ gfile = os.path.join(root,'Fv','Guid.xref')\r
+ if os.path.isfile(gfile):\r
+ return gfile\r
+ else:\r
+ print("ERROR: Guid.xref file not found")\r
+ ERRORMSG.append("ERROR: Guid.xref file not found")\r
+ exit()\r
+\r
+ def guid_dict(self):\r
+ guiddict={}\r
+ with open(self.guidfile,'r') as file:\r
+ lines = file.readlines()\r
+ guidinfo=lines\r
+ for line in guidinfo:\r
+ list=line.strip().split(' ')\r
+ if list:\r
+ if len(list)>1:\r
+ guiddict[list[0].upper()]=list[1]\r
+ elif list[0] != ''and len(list)==1:\r
+ print("Error: line %s can't be parser in %s"%(line.strip(),self.guidfile))\r
+ ERRORMSG.append("Error: line %s can't be parser in %s"%(line.strip(),self.guidfile))\r
+ else:\r
+ print("ERROR: No data in %s" %self.guidfile)\r
+ ERRORMSG.append("ERROR: No data in %s" %self.guidfile)\r
+ return guiddict\r
+\r
+ def guid_parser(self,guid):\r
+ if guid.upper() in self.guiddict:\r
+ return self.guiddict[guid.upper()]\r
+ else:\r
+ print("ERROR: GUID %s not found in file %s"%(guid, self.guidfile))\r
+ ERRORMSG.append("ERROR: GUID %s not found in file %s"%(guid, self.guidfile))\r
+ return guid\r
+\r
+class PATH(object):\r
+\r
+ def __init__(self,path):\r
+ self.path=path\r
+ self.rootdir=self.get_root_dir()\r
+ self.usefuldir=[]\r
+ self.lstinf = {}\r
+ for path in self.rootdir:\r
+ for o_root, o_dir, o_file in os.walk(os.path.join(path, "OUTPUT"), topdown=True, followlinks=False):\r
+ for INF in o_file:\r
+ if os.path.splitext(INF)[1] == '.inf':\r
+ for l_root, l_dir, l_file in os.walk(os.path.join(path, "DEBUG"), topdown=True,\r
+ followlinks=False):\r
+ for LST in l_file:\r
+ if os.path.splitext(LST)[1] == '.lst':\r
+ self.lstinf[os.path.join(l_root, LST)] = os.path.join(o_root, INF)\r
+ self.usefuldir.append(path)\r
+\r
+ def get_root_dir(self):\r
+ rootdir=[]\r
+ for root,dir,file in os.walk(self.path,topdown=True,followlinks=False):\r
+ if "OUTPUT" in root:\r
+ updir=root.split("OUTPUT",1)[0]\r
+ rootdir.append(updir)\r
+ rootdir=list(set(rootdir))\r
+ return rootdir\r
+\r
+ def lst_inf(self):\r
+ return self.lstinf\r
+\r
+ def package(self):\r
+ package={}\r
+ package_re=re.compile(r'Packages\.\w+]\n(.*)',re.S)\r
+ for i in list(self.lstinf.values()):\r
+ with open(i,'r') as inf:\r
+ read=inf.read()\r
+ section=read.split('[')\r
+ for j in section:\r
+ p=package_re.findall(j)\r
+ if p:\r
+ package[i]=p[0].rstrip()\r
+ return package\r
+\r
+ def header(self,struct):\r
+ header={}\r
+ head_re = re.compile(r'} %s;[\s\S\n]+h{1}"'%struct,re.M|re.S)\r
+ head_re2 = re.compile(r'#line[\s\d]+"(\S+h)"')\r
+ for i in list(self.lstinf.keys()):\r
+ with open(i,'r') as lst:\r
+ read = lst.read()\r
+ h = head_re.findall(read)\r
+ if h:\r
+ head=head_re2.findall(h[0])\r
+ if head:\r
+ format = head[0].replace('\\\\','/').replace('\\','/')\r
+ name =format.split('/')[-1]\r
+ head = self.makefile(name).replace('\\','/')\r
+ header[struct] = head\r
+ return header\r
+\r
+ def makefile(self,filename):\r
+ re_format = re.compile(r'DEBUG_DIR.*(?:\S+Pkg)\\(.*\\%s)'%filename)\r
+ for i in self.usefuldir:\r
+ with open(os.path.join(i,'Makefile'),'r') as make:\r
+ read = make.read()\r
+ dir = re_format.findall(read)\r
+ if dir:\r
+ return dir[0]\r
+\r
+class mainprocess(object):\r
+\r
+ def __init__(self,InputPath,Config,OutputPath):\r
+ self.init = 0xFCD00000\r
+ self.inputpath = os.path.abspath(InputPath)\r
+ self.outputpath = os.path.abspath(OutputPath)\r
+ self.LST = PATH(self.inputpath)\r
+ self.lst_dict = self.LST.lst_inf()\r
+ self.Config = Config\r
+ self.attribute_dict = {'0x3': 'NV, BS', '0x7': 'NV, BS, RT'}\r
+ self.guid = GUID(self.inputpath)\r
+ self.header={}\r
+\r
+ def main(self):\r
+ conf=Config(self.Config)\r
+ config_dict=conf.config_parser() #get {'0_0':[offset,name,guid,value,attribute]...,'1_0':....}\r
+ lst=parser_lst(list(self.lst_dict.keys()))\r
+ efi_dict=lst.efivarstore_parser() #get {name:struct} form lst file\r
+ keys=sorted(config_dict.keys())\r
+ all_struct=lst.struct()\r
+ stru_lst=lst.struct_lst()\r
+ title_list=[]\r
+ info_list=[]\r
+ header_list=[]\r
+ inf_list =[]\r
+ for i in stru_lst:\r
+ tmp = self.LST.header(i)\r
+ self.header.update(tmp)\r
+ for id_key in keys:\r
+ tmp_id=[id_key] #['0_0',[(struct,[name...]),(struct,[name...])]]\r
+ tmp_info={} #{name:struct}\r
+ for section in config_dict[id_key]:\r
+ c_offset,c_name,c_guid,c_value,c_attribute = section\r
+ if c_name in efi_dict:\r
+ struct = efi_dict[c_name]\r
+ title='%s%s|L"%s"|%s|0x00||%s\n'%(PCD_NAME,c_name,c_name,self.guid.guid_parser(c_guid),self.attribute_dict[c_attribute])\r
+ if struct in all_struct:\r
+ lstfile = stru_lst[struct]\r
+ struct_dict=all_struct[struct]\r
+ try:\r
+ title2 = '%s%s|{0}|%s|0xFCD00000{\n <HeaderFiles>\n %s\n <Packages>\n%s\n}\n' % (PCD_NAME, c_name, struct, self.header[struct], self.LST.package()[self.lst_dict[lstfile]])\r
+ except KeyError:\r
+ WARNING.append("Warning: No <HeaderFiles> for struct %s"%struct)\r
+ title2 = '%s%s|{0}|%s|0xFCD00000{\n <HeaderFiles>\n %s\n <Packages>\n%s\n}\n' % (PCD_NAME, c_name, struct, '', self.LST.package()[self.lst_dict[lstfile]])\r
+ header_list.append(title2)\r
+ else:\r
+ struct_dict ={}\r
+ print("ERROR: Struct %s can't found in lst file" %struct)\r
+ ERRORMSG.append("ERROR: Struct %s can't found in lst file" %struct)\r
+ if c_offset in struct_dict:\r
+ offset_name=struct_dict[c_offset]\r
+ info = "%s%s.%s|%s\n"%(PCD_NAME,c_name,offset_name,c_value)\r
+ inf = "%s%s\n"%(PCD_NAME,c_name)\r
+ inf_list.append(inf)\r
+ tmp_info[info]=title\r
+ else:\r
+ print("ERROR: Can't find offset %s with struct name %s"%(c_offset,struct))\r
+ ERRORMSG.append("ERROR: Can't find offset %s with name %s"%(c_offset,struct))\r
+ else:\r
+ print("ERROR: Can't find name %s in lst file"%(c_name))\r
+ ERRORMSG.append("ERROR: Can't find name %s in lst file"%(c_name))\r
+ tmp_id.append(list(self.reverse_dict(tmp_info).items()))\r
+ id,tmp_title_list,tmp_info_list = self.read_list(tmp_id)\r
+ title_list +=tmp_title_list\r
+ info_list.append(tmp_info_list)\r
+ inf_list = self.del_repeat(inf_list)\r
+ header_list = self.plus(self.del_repeat(header_list))\r
+ title_all=list(set(title_list))\r
+ info_list = self.del_repeat(info_list)\r
+ for i in range(len(info_list)-1,-1,-1):\r
+ if len(info_list[i]) == 0:\r
+ info_list.remove(info_list[i])\r
+ return keys,title_all,info_list,header_list,inf_list\r
+\r
+\r
+ def write_all(self):\r
+ title_flag=1\r
+ info_flag=1\r
+ if not os.path.isdir(self.outputpath):\r
+ os.makedirs(self.outputpath)\r
+ decwrite = write2file(os.path.join(self.outputpath,'StructurePcd.dec'))\r
+ dscwrite = write2file(os.path.join(self.outputpath,'StructurePcd.dsc'))\r
+ infwrite = write2file(os.path.join(self.outputpath, 'StructurePcd.inf'))\r
+ conf = Config(self.Config)\r
+ ids,title,info,header,inf=self.main()\r
+ decwrite.add2file(decstatement)\r
+ decwrite.add2file(header)\r
+ infwrite.add2file(infstatement)\r
+ infwrite.add2file(inf)\r
+ dscwrite.add2file(dscstatement)\r
+ for id in ids:\r
+ dscwrite.add2file(conf.eval_id(id))\r
+ if title_flag:\r
+ dscwrite.add2file(title)\r
+ title_flag=0\r
+ if len(info) == 1:\r
+ dscwrite.add2file(info)\r
+ elif len(info) == 2:\r
+ if info_flag:\r
+ dscwrite.add2file(info[0])\r
+ info_flag =0\r
+ else:\r
+ dscwrite.add2file(info[1])\r
+\r
+ def del_repeat(self,List):\r
+ if len(List) == 1 or len(List) == 0:\r
+ return List\r
+ else:\r
+ if type(List[0]) != type('xxx'):\r
+ alist=[]\r
+ for i in range(len(List)):\r
+ if i == 0:\r
+ alist.append(List[0])\r
+ else:\r
+ plist = []\r
+ for j in range(i):\r
+ plist += List[j]\r
+ alist.append(self.__del(list(set(plist)), List[i]))\r
+ return alist\r
+ else:\r
+ return list(set(List))\r
+\r
+\r
+ def __del(self,list1,list2):\r
+ return list(set(list2).difference(set(list1)))\r
+\r
+ def reverse_dict(self,dict):\r
+ data={}\r
+ for i in list(dict.items()):\r
+ if i[1] not in list(data.keys()):\r
+ data[i[1]]=[i[0]]\r
+ else:\r
+ data[i[1]].append(i[0])\r
+ return data\r
+\r
+ def read_list(self,list):\r
+ title_list=[]\r
+ info_list=[]\r
+ for i in list[1]:\r
+ title_list.append(i[0])\r
+ for j in i[1]:\r
+ info_list.append(j)\r
+ return list[0],title_list,info_list\r
+\r
+ def plus(self,list):\r
+ nums=[]\r
+ for i in list:\r
+ if type(i) != type([0]):\r
+ self.init += 1\r
+ num = "0x%01x" % self.init\r
+ j=i.replace('0xFCD00000',num.upper())\r
+ nums.append(j)\r
+ return nums\r
+\r
+class write2file(object):\r
+\r
+ def __init__(self,Output):\r
+ self.output=Output\r
+ self.text=''\r
+ if os.path.exists(self.output):\r
+ os.remove(self.output)\r
+\r
+ def add2file(self,content):\r
+ self.text = ''\r
+ with open(self.output,'a+') as file:\r
+ file.write(self.__gen(content))\r
+\r
+ def __gen(self,content):\r
+ if type(content) == type(''):\r
+ return content\r
+ elif type(content) == type([0,0])or type(content) == type((0,0)):\r
+ return self.__readlist(content)\r
+ elif type(content) == type({0:0}):\r
+ return self.__readdict(content)\r
+\r
+ def __readlist(self,list):\r
+ for i in list:\r
+ if type(i) == type([0,0])or type(i) == type((0,0)):\r
+ self.__readlist(i)\r
+ elif type(i) == type('') :\r
+ self.text +=i\r
+ return self.text\r
+\r
+ def __readdict(self,dict):\r
+ content=list(dict.items())\r
+ return self.__readlist(content)\r
+\r
+def stamp():\r
+ return datetime.datetime.now()\r
+\r
+def dtime(start,end,id=None):\r
+ if id:\r
+ pass\r
+ print("%s time:%s" % (id,str(end - start)))\r
+ else:\r
+ print("Total time:%s" %str(end-start)[:-7])\r
+\r
+\r
+def main():\r
+ start = stamp()\r
+ parser = argparse.ArgumentParser(prog = __prog__,\r
+ description = __description__ + __copyright__,\r
+ conflict_handler = 'resolve')\r
+ parser.add_argument('-v', '--version', action = 'version',version = __version__, help="show program's version number and exit")\r
+ parser.add_argument('-p', '--path', metavar='PATH', dest='path', help="platform build output directory")\r
+ parser.add_argument('-c', '--config',metavar='FILENAME', dest='config', help="firmware configuration file")\r
+ parser.add_argument('-o', '--outputdir', metavar='PATH', dest='output', help="output directoy")\r
+ options = parser.parse_args()\r
+ if options.config:\r
+ if options.path:\r
+ if options.output:\r
+ run = mainprocess(options.path, options.config, options.output)\r
+ print("Running...")\r
+ run.write_all()\r
+ if WARNING:\r
+ warning = list(set(WARNING))\r
+ for j in warning:\r
+ print(j)\r
+ if ERRORMSG:\r
+ ERROR = list(set(ERRORMSG))\r
+ with open("ERROR.log", 'w+') as error:\r
+ for i in ERROR:\r
+ error.write(i + '\n')\r
+ print("Some error find, error log in ERROR.log")\r
+ print('Finished, Output files in directory %s'%os.path.abspath(options.output))\r
+ else:\r
+ print('Error command, no output path, use -h for help')\r
+ else:\r
+ print('Error command, no build path input, use -h for help')\r
+ else:\r
+ print('Error command, no output file, use -h for help')\r
+ end = stamp()\r
+ dtime(start, end)\r
+\r
+if __name__ == '__main__':\r
+ main()\r